ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry

Bis[(2-di-i-propylphosphino]ethyl)amine

Catalog Number ACM131890261
CAS 131890-26-1
Structure Bis[(2-di-i-propylphosphino]ethyl)amine
Synonyms Bis((2-diisopropylphosphino)ethyl)-amine
IUPAC Name 2-di(propan-2-yl)phosphanyl-N-[2-di(propan-2-yl)phosphanylethyl]ethanamine
Molecular Weight 305.42
Molecular Formula C16H37NP2
InChI FTVIGQGOGIHMBS-UHFFFAOYSA-N
InChI Key InChI=1S/C16H37NP2/c1-13(2)18(14(3)4)11-9-17-10-12-19(15(5)6)16(7)8/h13-17H,9-12H2,1-8H3
Boiling Point 375.9±27.0 °C(Predicted)
Flash Point -17 °C
Purity 98%
Density 0.884 g/mL at 25 °C
Appearance Liquid
Isomeric SMILES CC(C)P(CCNCCP(C(C)C)C(C)C)C(C)C
pKa 10.42±0.19(Predicted)
Q&A

What is the CAS number of Bis[(2-di-i-propylphosphino]ethyl)amine?

The CAS number of Bis[(2-di-i-propylphosphino]ethyl)amine is 131890-26-1.

What is the Canonical SMILES representation of Bis[(2-di-i-propylphosphino]ethyl)amine?

The Canonical SMILES representation of Bis[(2-di-i-propylphosphino]ethyl)amine is CC(C)P(CCNCCP(C(C)C)C(C)C)C(C)C.

How many heavy atoms are present in the molecular structure of Bis[(2-di-i-propylphosphino]ethyl)amine?

There are 19 heavy atoms present in the molecular structure of Bis[(2-di-i-propylphosphino]ethyl)amine.

What is the Computed Properties Rotatable Bond Count for Bis[(2-di-i-propylphosphino]ethyl)amine?

The Computed Properties Rotatable Bond Count for Bis[(2-di-i-propylphosphino]ethyl)amine is 10.

What is the exact mass of Bis[(2-di-i-propylphosphino]ethyl)amine?

The exact mass of Bis[(2-di-i-propylphosphino]ethyl)amine is 305.24012418.

What is the molecular formula of Bis[(2-di-i-propylphosphino]ethyl)amine?

The molecular formula of Bis[(2-di-i-propylphosphino]ethyl)amine is C16H37NP2.

What is the IUPAC name of Bis[(2-di-i-propylphosphino]ethyl)amine?

The IUPAC name of Bis[(2-di-i-propylphosphino]ethyl)amine is 2-di(propan-2-yl)phosphanyl-N-[2-di(propan-2-yl)phosphanylethyl]ethanamine.

What is the InChIKey for Bis[(2-di-i-propylphosphino]ethyl)amine?

The InChIKey for Bis[(2-di-i-propylphosphino]ethyl)amine is FTVIGQGOGIHMBS-UHFFFAOYSA-N.

What is the molecular weight of Bis[(2-di-i-propylphosphino]ethyl)amine?

The molecular weight of Bis[(2-di-i-propylphosphino]ethyl)amine is 305.42g/mol.

What is the common name for Bis[(2-di-i-propylphosphino]ethyl)amine?

The common name for Bis[(2-di-i-propylphosphino]ethyl)amine is bis(2(diisopropylphosphino)ethyl)amine.

Please kindly note that our products and services are for research use only.