Bis(2,4-hexanedionato)copper

Catalog Number	ACM13878449
CAS	13878-44-9
Synonyms	Copper;hexane-2,4-dione
Molecular Weight	291.83
Molecular Formula	C12H20CuO4
Canonical SMILES	CCC(=O)CC(=O)C.CCC(=O)CC(=O)C.[Cu]
InChI	InChI=1S/2C6H10O2.Cu/c2*1-3-6(8)4-5(2)7;/h2*3-4H2,1-2H3;
InChI Key	YHTNYKOVKQZJCS-UHFFFAOYSA-N
Purity	98%
Complexity	244
Covalently-Bonded Unit Count	3
Defined Atom Stereocenter Count	0
Exact Mass	291.065756
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
Monoisotopic Mass	291.065756
Rotatable Bond Count	2
Topological Polar Surface Area	68.3 Ų

Q&A

What is the chemical formula for Bis(2,4-hexanedionato)copper?

The chemical formula for Bis(2,4-hexanedionato)copper is C12H18CuO4.

What is the molecular weight of Bis(2,4-hexanedionato)copper?

The molecular weight of Bis(2,4-hexanedionato)copper is 289.81492.

What is the CAS number of Bis(2,4-hexanedionato)copper?

The CAS number of Bis(2,4-hexanedionato)copper is 15489-81-3.

What is another name for Bis(2,4-hexanedionato)copper?

Another name for Bis(2,4-hexanedionato)copper is Nsc 402482.

What are some synonyms for Bis(2,4-hexanedionato)copper?

Some synonyms for Bis(2,4-hexanedionato)copper include Copper, bis(2,4-hexanedionato-kappao,kappao')- and Copper, bis(2,4-hexanedionato-kappao2,kappao4)-.

What are the possible binding configurations of the hexanedionate ligands in Bis(2,4-hexanedionato)copper?

The possible binding configurations of the hexanedionate ligands in Bis(2,4-hexanedionato)copper include kappa, kappa', kappa2, kappa4, and o,o'.

What is the chemical structure of Bis(2,4-hexanedionato)copper?

The chemical structure of Bis(2,4-hexanedionato)copper consists of a copper atom coordinated with two 2,4-hexanedionate ligands.

What is the molecular formula of Bis(2,4-hexanedionato)copper?

The molecular formula of Bis(2,4-hexanedionato)copper is C12H18CuO4.

How many carbon atoms are present in each 2,4-hexanedionate ligand?

Each 2,4-hexanedionate ligand contains six carbon atoms.

What are some possible applications of Bis(2,4-hexanedionato)copper in chemistry or industry?

Bis(2,4-hexanedionato)copper can be used in various chemical reactions, catalysts, or as a precursor for the synthesis of other copper-containing compounds in the chemical industry.