Bis[1,2-bis(diphenylphosphino)ethane]palladium(0)

Catalog Number	ACM31277982-1
CAS	31277-98-2
Structure
Synonyms	2-Diphenylphosphanylethyl(diphenyl)phosphane;palladium
IUPAC Name	2-diphenylphosphanylethyl(diphenyl)phosphane;palladium;
Molecular Weight	903.2
Molecular Formula	C52H48P4Pd
Canonical SMILES	C1=CC=C(C=C1)P(CCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.C1=CC=C(C=C1)P(CCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.[Pd]
InChI	InChI=1S/2C26H24P2.Pd/c2*1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;/h2*1-20H,21-22H2;
InChI Key	FAFGMAGIYHHRKN-UHFFFAOYSA-N
Melting Point	219-225 °C
Purity	96%
Appearance	Powder
Application	suzuki reaction
Storage	Freezer
Complexity	336
Covalently-Bonded Unit Count	3
Exact Mass	902.17413
Heavy Atom Count	57
Hydrogen Bond Acceptor Count	0
Hydrogen Bond Donor Count	0
Monoisotopic Mass	902.17413
Rotatable Bond Count	14
Topological Polar Surface Area	0 Ų

Q&A

What is the molecular formula of Bis[1,2-bis(diphenylphosphino)ethane]palladium(0)?

The molecular formula is C52H48P4Pd.

When was Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) created and last modified?

It was created on July 19, 2005, and last modified on December 30, 2023.

What is the IUPAC name of Bis[1,2-bis(diphenylphosphino)ethane]palladium(0)?

The IUPAC name is 2-diphenylphosphanylethyl(diphenyl)phosphane;palladium.

What is the Canonical SMILES representation of Bis[1,2-bis(diphenylphosphino)ethane]palladium(0)?

The Canonical SMILES representation is C1=CC=C(C=C1)P(CCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.C1=CC=C(C=C1)P(CCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.[Pd].

What is the CAS number for Bis[1,2-bis(diphenylphosphino)ethane]palladium(0)?

The CAS number is 31277-98-2.

How many hydrogen bond donor counts does Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) have?

It has 0 hydrogen bond donor counts.

What is the exact mass of Bis[1,2-bis(diphenylphosphino)ethane]palladium(0)?

The exact mass is 902.17413 g/mol.

How many rotatable bond counts does Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) have?

It has 14 rotatable bond counts.

What is the topological polar surface area of Bis[1,2-bis(diphenylphosphino)ethane]palladium(0)?

The topological polar surface area is 0?2.

Is the compound Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) canonicalized?

Yes, the compound is canonicalized.

What are the synonyms for Bis[1,2-bis(diphenylphosphino)ethane]palladium(0)?

The synonyms include Pd(DIPHOS), Pd(dppe)2, and 2-diphenylphosphanylethyl(diphenyl)phosphane;palladium.

What are the component compounds of Bis[1,2-bis(diphenylphosphino)ethane]palladium(0)?

The component compounds are Palladium (CID 23938) and 1,2-Bis(diphenylphosphino)ethane (CID 74267).

What is the InChIKey of Bis[1,2-bis(diphenylphosphino)ethane]palladium(0)?

The InChIKey is FAFGMAGIYHHRKN-UHFFFAOYSA-N.

What is the molecular weight of Bis[1,2-bis(diphenylphosphino)ethane]palladium(0)?

The molecular weight is 903.2 g/mol.

What is the exact mass and monoisotopic mass of Bis[1,2-bis(diphenylphosphino)ethane]palladium(0)?

The exact mass and monoisotopic mass are 902.17413 g/mol.

Is Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) canonicalized?

Yes, the compound is canonicalized.