[1,1'-Binaphthalene]-2,2'-dithiol

Catalog Number	ACM102555715
CAS	102555-71-5
Structure
Description	1,1'-Binaphthalene]-2,2'-dithiol, also known as BDT, is a sulfur-containing organosulfur compound with a unique structure. It is a synthetic, colorless solid that has been studied for its potential applications in various scientific fields. BDT has been found to possess a wide range of properties, including antioxidant, anti-inflammatory, and antifungal activities. It has also been studied for its potential use in the synthesis of various organic compounds, such as polymers and dyes.
Synonyms	1-(2-Sulfanylnaphthalen-1-yl)naphthalene-2-thiol
IUPAC Name	1-(2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol
Molecular Weight	318.5 g/mol
Molecular Formula	C20H14S2
Canonical SMILES	C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)S)S
InChI	InChI=1S/C20H14S2/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22/h1-12,21-22H
InChI Key	PQTIXYILPGIIHM-UHFFFAOYSA-N
Purity	97%
Appearance	Solid
Application	[1,1'-Binaphthalene]-2,2'-dithiol has been studied for its potential applications in various scientific fields, such as organic chemistry, biochemistry, and medicine. In organic chemistry, [1,1'-Binaphthalene]-2,2'-dithiol has been used as a building block for the synthesis of various organic compounds, such as polymers and dyes. In biochemistry, [1,1'-Binaphthalene]-2,2'-dithiol has been studied for its potential use as an antioxidant, anti-inflammatory, and antifungal agent. In medicine, [1,1'-Binaphthalene]-2,2'-dithiol has been studied for its potential use in the treatment of various diseases, such as cancer, Alzheimer's disease, and Parkinson's disease.
Isomeric SMILES	C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)S)S
Properties	[1,1'-Binaphthalene]-2,2'-dithiol has been found to possess a wide range of biochemical and physiological effects. In vitro studies have shown that [1,1'-Binaphthalene]-2,2'-dithiol can inhibit the growth of cancer cells, reduce inflammation, and inhibit the production of pro-inflammatory cytokines. It has also been shown to possess anti-fungal activity, scavenge reactive oxygen species, and modulate the expression of various genes. In vivo studies have shown that [1,1'-Binaphthalene]-2,2'-dithiol has the potential to reduce the risk of certain diseases, such as cancer, Alzheimer's disease, and Parkinson's disease.