| Catalog Number |
ACM14098249-1 |
| CAS |
14098-24-9 |
| Structure |
 |
| Description |
Benzo-18-crown-6 (also known as 18-crown-6, 18C6, or B18C6) is a macrocyclic polyether compound composed of 18 carbon atoms arranged in a macrocyclic ring. It is a colorless, crystalline solid that is soluble in many organic solvents. Benzo-18-crown-6 has been studied extensively for its unique properties and has been used in a wide range of scientific applications, including synthesis and reaction catalysis, drug delivery, and molecular recognition. This paper will discuss the synthesis methods, scientific research applications, mechanism of action, biochemical and physiological effects, advantages and limitations for lab experiments, and potential future directions of Benzo-18-crown-6. |
| IUPAC Name |
2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(22),18,20-triene |
| Molecular Weight |
312.36 g/mol |
| Molecular Formula |
C16H24O6 |
| Canonical SMILES |
C1COCCOCCOC2=CC=CC=C2OCCOCCO1 |
| InChI |
InChI=1S/C16H24O6/c1-2-4-16-15(3-1)21-13-11-19-9-7-17-5-6-18-8-10-20-12-14-22-16/h1-4H,5-14H2 |
| InChI Key |
DSFHXKRFDFROER-UHFFFAOYSA-N |
| Appearance |
Powder |
| Application |
Benzo-18-crown-6 has been used in a wide range of scientific applications, including synthesis and reaction catalysis, drug delivery, and molecular recognition. It has been used as a catalyst in organic synthesis reactions, such as the synthesis of polyethers, and can be used as a ligand to increase the solubility of organic compounds in water. Benzo-18-crown-6 has also been used in drug delivery systems to target specific tissues or organs and to increase the bioavailability of drugs. In addition, it has been used in molecular recognition studies to detect and identify specific molecules. |
| GHS Pictogram |
Irritant |
| Properties |
The biochemical and physiological effects of Benzo-18-crown-6 are largely unknown. While it has been used as a drug delivery system, the compound itself is not known to have any direct effects on the body. However, it has been used in the synthesis of polyethers, which are known to have a wide range of effects on the body, including anti-inflammatory, anti-cancer, and anti-bacterial properties. |
