Acetylacetonatobis(ethylene)rhodium(I)

Catalog Number	ACM12082472-1
CAS	12082-47-2
Structure
Synonyms	Bis(ethylene)rhodium(I) acetylacetonate
IUPAC Name	ethene;(Z)-4-hydroxypent-3-en-2-one;rhodium;
Molecular Weight	259.13
Molecular Formula	C9H16O2Rh
Canonical SMILES	CC(=CC(=O)C)O.C=C.C=C.[Rh]
InChI	InChI=1S/C5H8O2.2C2H4.Rh/c1-4(6)3-5(2)7;2*1-2;/h3,6H,1-2H3;2*1-2H2;/b4-3-;
InChI Key	AFQSOHSPTULSFS-FGSKAQBVSA-N
Melting Point	141-142 °C
Purity	98%
Appearance	Orange crystal or crystalline powder
Storage	2-8°C
Complexity	107
Covalently-Bonded Unit Count	4
Defined Atom Stereocenter Count	0
EC Number	235-147-1
Exact Mass	259.02052
Heavy Atom Count	12
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C(=C/C(=O)C)/O.C=C.C=C.[Rh]
Monoisotopic Mass	259.02052
Rotatable Bond Count	1
Topological Polar Surface Area	37.3 Ų

Q&A

What is the molecular formula of Acetylacetonatobis(ethylene)rhodium(I)?

The molecular formula of Acetylacetonatobis(ethylene)rhodium(I) is C9H16O2Rh.

What is the molecular weight of Acetylacetonatobis(ethylene)rhodium(I)?

The molecular weight of Acetylacetonatobis(ethylene)rhodium(I) is 259.13 g/mol.

What are some synonyms for Acetylacetonatobis(ethylene)rhodium(I)?

Some synonyms for Acetylacetonatobis(ethylene)rhodium(I) include ethene, (Z)-4-hydroxypent-3-en-2-one, and Rh(acac)(C2H4)2.

When was Acetylacetonatobis(ethylene)rhodium(I) created and last modified?

Acetylacetonatobis(ethylene)rhodium(I) was created on 2006-10-26 and last modified on 2023-12-30.

What are the component compounds of Acetylacetonatobis(ethylene)rhodium(I)?

The component compounds of Acetylacetonatobis(ethylene)rhodium(I) include 3-Penten-2-one, 4-hydroxy-, Ethylene, and Rhodium.

What is the IUPAC name of Acetylacetonatobis(ethylene)rhodium(I)?

The IUPAC name of Acetylacetonatobis(ethylene)rhodium(I) is ethene, (Z)-4-hydroxypent-3-en-2-one, rhodium.

What is the InChIKey of Acetylacetonatobis(ethylene)rhodium(I)?

The InChIKey of Acetylacetonatobis(ethylene)rhodium(I) is AFQSOHSPTULSFS-FGSKAQBVSA-N.

What is the hydrogen bond donor count of Acetylacetonatobis(ethylene)rhodium(I)?

The hydrogen bond donor count of Acetylacetonatobis(ethylene)rhodium(I) is 1.

What is the rotatable bond count of Acetylacetonatobis(ethylene)rhodium(I)?

The rotatable bond count of Acetylacetonatobis(ethylene)rhodium(I) is 1.

Is the compound Acetylacetonatobis(ethylene)rhodium(I) canonicalized?

Yes, the compound Acetylacetonatobis(ethylene)rhodium(I) is canonicalized.

When was Acetylacetonatobis(ethylene)rhodium(I) created?

2006-10-26

How many component compounds are included in Acetylacetonatobis(ethylene)rhodium(I)?

Three component compounds are included: 3-Penten-2-one, ethylene, and rhodium.

How many hydrogen bond donor counts does Acetylacetonatobis(ethylene)rhodium(I) have?

1

What is the exact mass of Acetylacetonatobis(ethylene)rhodium(I)?

259.02052 g/mol

How many rotatable bond counts does Acetylacetonatobis(ethylene)rhodium(I) have?

1

What is the topological polar surface area of Acetylacetonatobis(ethylene)rhodium(I)?

37.3 Å2

How many defined atom stereocenter counts does Acetylacetonatobis(ethylene)rhodium(I) have?

0

Is Acetylacetonatobis(ethylene)rhodium(I) a canonicalized compound?

Yes