What is the CAS number for (9-Butyl-9-fluorenyl)dicyclohexylphosphonium tetrafluoroborate?
The CAS number is 1007311-98-9.
What is the molecular formula of (9-Butyl-9-fluorenyl)dicyclohexylphosphonium tetrafluoroborate?
The molecular formula is C29H40BF4P.
What is the molecular weight of (9-Butyl-9-fluorenyl)dicyclohexylphosphonium tetrafluoroborate?
The molecular weight is 506.4g/mol.
How many heavy atoms are present in (9-Butyl-9-fluorenyl)dicyclohexylphosphonium tetrafluoroborate?
There are 35 heavy atoms present.
What is the IUPAC name of (9-Butyl-9-fluorenyl)dicyclohexylphosphonium tetrafluoroborate?
The IUPAC name is (9-butylfluoren-9-yl)-dicyclohexylphosphanium;tetrafluoroborate.
What is the InChIKey for (9-Butyl-9-fluorenyl)dicyclohexylphosphonium tetrafluoroborate?
The InChIKey is CBQHWERYDVYPPB-UHFFFAOYSA-O.
How many rotatable bonds are present in (9-Butyl-9-fluorenyl)dicyclohexylphosphonium tetrafluoroborate?
There are 6 rotatable bonds present.
What is the exact mass of (9-Butyl-9-fluorenyl)dicyclohexylphosphonium tetrafluoroborate?
The exact mass is 506.2896811.
What is the name given to (9-Butyl-9-fluorenyl)dicyclohexylphosphonium tetrafluoroborate in the Depositor-Supplied Synonyms?
The name given is Dicyclohexyl(9-butylfluoren-9-yl)phosphonium tetrafluoroborate.
What is the canonical SMILES representation of (9-Butyl-9-fluorenyl)dicyclohexylphosphonium tetrafluoroborate?
The canonical SMILES representation is [B-](F)(F)(F)F.CCCCC1(C2=CC=CC=C2C3=CC=CC=C31)[PH+](C4CCCCC4)C5CCCCC5.