What is the CAS number for (9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(di-o-tolylphosphine)?
The CAS number is 205497-65-0.
What is the molecular formula of (9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(di-o-tolylphosphine)?
The molecular formula is C43H40OP2.
What is the molecular weight of (9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(di-o-tolylphosphine)?
The molecular weight is 634.7g/mol.
How many heavy atoms are present in (9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(di-o-tolylphosphine)?
There are 46 heavy atoms.
What is the Canonical SMILES representation of (9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(di-o-tolylphosphine)?
CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC4=C3OC5=C(C4(C)C)C=CC=C5P(C6=CC=CC=C6C)C7=CC=CC=C7C
How many rotatable bonds are there in (9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(di-o-tolylphosphine)?
There are 6 rotatable bonds.
What is the Exact Mass of (9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(di-o-tolylphosphine)?
The Exact Mass is 634.25543989.
What is the IUPAC Name of (9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(di-o-tolylphosphine)?
[5-bis(2-methylphenyl)phosphanyl-9,9-dimethylxanthen-4-yl]-bis(2-methylphenyl)phosphane
How many Hydrogen Bond Acceptor Count does (9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(di-o-tolylphosphine) have?
It has 1 Hydrogen Bond Acceptor Count.
What is the InChIKey for (9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(di-o-tolylphosphine)?
LRBMIJWNZORINX-UHFFFAOYSA-N