What is the IUPAC name of 8-((Di-tert-butylphosphanyl)oxy)quinoline?
The IUPAC name of 8-((Di-tert-butylphosphanyl)oxy)quinoline is ditert-butyl(quinolin-8-yloxy)phosphane.
How many heavy atoms are present in the molecular formula C17H24NOP?
There are 20 heavy atoms present in the molecular formula.
What is the exact mass of 8-((Di-tert-butylphosphanyl)oxy)quinoline with the molecular formula C17H24NOP?
The exact mass is 289.159551387 g/mol.
How many hydrogen bond acceptors does 8-((Di-tert-butylphosphanyl)oxy)quinoline have?
8-((Di-tert-butylphosphanyl)oxy)quinoline has 2 hydrogen bond acceptors.
What is the Canonical SMILES representation of 8-((Di-tert-butylphosphanyl)oxy)quinoline?
CC(C)(C)P(C(C)(C)C)OC1=CC=CC2=C1N=CC=C2
How many rotatable bonds are present in 8-((Di-tert-butylphosphanyl)oxy)quinoline?
There are 4 rotatable bonds present in 8-((Di-tert-butylphosphanyl)oxy)quinoline.
What is the EC Number of 8-((Di-tert-butylphosphanyl)oxy)quinoline?
The European Community (EC) Number is 802-316-1.
What is the InChIKey of 8-((Di-tert-butylphosphanyl)oxy)quinoline?
The InChIKey is YQGSMFFFCCUOHT-UHFFFAOYSA-N.
How complex is 8-((Di-tert-butylphosphanyl)oxy)quinoline based on the Computed Properties Complexity?
The Complexity is 304.
What is the Depositor-Supplied Synonym of 8-((Di-tert-butylphosphanyl)oxy)quinoline with the CAS number 1100332-44-2?
The Depositor-Supplied Synonym is 8-((Di-tert-butylphosphanyl)oxy)quinoline.