5-Carboxy-2,2'-bipyridine

Catalog Number	ACM1970805-2
CAS	1970-80-5
Structure
Synonyms	5-Carboxy-2,2'-Bipyridine; 6-(Pyridin-2-Yl)Pyridine-3-Carboxylic Acid
IUPAC Name	6-pyridin-2-ylpyridine-3-carboxylic acid
Molecular Weight	200.19
Molecular Formula	C11H8N2O2
InChI	LWMHPOLRJIRLPN-UHFFFAOYSA-N
InChI Key	InChI=1S/C11H8N2O2/c14-11(15)8-4-5-10(13-7-8)9-3-1-2-6-12-9/h1-7H,(H,14,15)
Melting Point	218-220 °C
Purity	97%
Isomeric SMILES	C1=CC=NC(=C1)C2=NC=C(C=C2)C(=O)O

Q&A

What is the molecular weight of 5-Carboxy-2,2'-bipyridine?

The molecular weight is 200.19.

What are the product categories that 5-Carboxy-2,2'-bipyridine falls under?

Carboxylic Acids, Pyridines, Carboxylic Acids.

What is the synonym for 5-Carboxy-2,2'-bipyridine?

2,2'-BIPYRIDINE-5-CARBOXYLIC ACID.

What is the melting point of 5-Carboxy-2,2'-bipyridine?

The melting point is 218-220 °C.

What is the density of 5-Carboxy-2,2'-bipyridine?

The density is 1.302±0.06 g/cm3 (Predicted).

What is the boiling point of 5-Carboxy-2,2'-bipyridine?

The boiling point is 405.5±35.0 °C (Predicted).

What is the storage recommendation for 5-Carboxy-2,2'-bipyridine?

It should be sealed in dry, at room temperature.

What is the pka value of 5-Carboxy-2,2'-bipyridine?

The pka value is 2.44±0.10 (Predicted).

What is the application of 5-Carboxy-2,2'-bipyridine?

It is a useful research chemical.

What is the HS Code for 5-Carboxy-2,2'-bipyridine?

The HS Code is 2916399090.