5'-Bromo-3-methyl-2,2'-bipyridine

Catalog Number	ACM1159281272
CAS	1159281-27-2
Synonyms	2-(5-Bromopyridin-2-yl)-3-methylpyridine
IUPAC Name	2-(5-bromopyridin-2-yl)-3-methylpyridine
Molecular Weight	249.11
Molecular Formula	C11H9BrN2
InChI	HQBYDNBCRHSMFS-UHFFFAOYSA-N
InChI Key	InChI=1S/C11H9BrN2/c1-8-3-2-6-13-11(8)10-5-4-9(12)7-14-10/h2-7H,1H3
Purity	97%
Isomeric SMILES	CC1=C(N=CC=C1)C2=NC=C(C=C2)Br

Q&A

What is the molecular weight of 5'-Bromo-3-methyl-2,2'-bipyridine?

The molecular weight of 5'-Bromo-3-methyl-2,2'-bipyridine is 249.11.

What are the synonyms for 5'-Bromo-3-methyl-2,2'-bipyridine?

The synonyms for 5'-Bromo-3-methyl-2,2'-bipyridine are 5'-Bromo-3-methyl-[2,2']bipyridinyl and 2,2'-Bipyridine, 5'-bromo-3-methyl-.

What is the molecular formula of 5'-Bromo-3-methyl-2,2'-bipyridine?

The molecular formula of 5'-Bromo-3-methyl-2,2'-bipyridine is C11H9BrN2.

What is the predicted boiling point of 5'-Bromo-3-methyl-2,2'-bipyridine?

The predicted boiling point of 5'-Bromo-3-methyl-2,2'-bipyridine is 319.6±37.0 °C.

What is the predicted pKa value of 5'-Bromo-3-methyl-2,2'-bipyridine?

The predicted pKa value of 5'-Bromo-3-methyl-2,2'-bipyridine is 3.84±0.32.

What is the predicted density of 5'-Bromo-3-methyl-2,2'-bipyridine?

The predicted density of 5'-Bromo-3-methyl-2,2'-bipyridine is 1.434±0.06 g/cm3.

What is the CAS number of 5'-Bromo-3-methyl-2,2'-bipyridine?

The CAS number of 5'-Bromo-3-methyl-2,2'-bipyridine is 1159281-27-2.

What functional groups are present in 5'-Bromo-3-methyl-2,2'-bipyridine?

The functional groups present in 5'-Bromo-3-methyl-2,2'-bipyridine are a bromine group, a methyl group, and a bipyridine group.

Is 5'-Bromo-3-methyl-2,2'-bipyridine a solid or a liquid at room temperature?

Based on the provided information, it is not specified whether 5'-Bromo-3-methyl-2,2'-bipyridine is a solid or a liquid at room temperature.

How can 5'-Bromo-3-methyl-2,2'-bipyridine be synthesized in the laboratory?

The synthesis of 5'-Bromo-3-methyl-2,2'-bipyridine can be achieved through appropriate chemical reactions involving suitable starting materials.