ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

5-Bromo-2-methyl-2-pentene

Catalog Number ACM2270599-1
CAS 2270-59-9
Structure {[CurrentData.Name]}
Synonyms 5-Bromo-2-methylpent-2-ene; 1-Bromo-4-methyl-3-pentene; 2-Methyl-5-bromo-2-pentene
IUPAC Name 5-bromo-2-methylpent-2-ene
Molecular Weight 163.06
Molecular Formula C6H11Br
InChI UNXURIHDFUQNOC-UHFFFAOYSA-N
InChI Key InChI=1S/C6H11Br/c1-6(2)4-3-5-7/h4H,3,5H2,1-2H3
Boiling Point 152-154 °C (lit.)
Flash Point 73 °F
Purity 97%
Density 1.217 g/cm3 at 25 °C(lit.)
Isomeric SMILES CC(=CCCBr)C
Q&A

What is the molecular formula of 5-Bromo-2-methyl-2-pentene?

The molecular formula of 5-Bromo-2-methyl-2-pentene is C6H11Br.

What is the molecular weight of 5-Bromo-2-methyl-2-pentene?

The molecular weight of 5-Bromo-2-methyl-2-pentene is 163.06 g/mol.

What is the IUPAC name of 5-Bromo-2-methyl-2-pentene?

The IUPAC name of 5-Bromo-2-methyl-2-pentene is 5-bromo-2-methylpent-2-ene.

What is the InChI of 5-Bromo-2-methyl-2-pentene?

The InChI of 5-Bromo-2-methyl-2-pentene is InChI=1S/C6H11Br/c1-6(2)4-3-5-7/h4H,3,5H2,1-2H3.

What is the InChIKey of 5-Bromo-2-methyl-2-pentene?

The InChIKey of 5-Bromo-2-methyl-2-pentene is UNXURIHDFUQNOC-UHFFFAOYSA-N.

What is the canonical SMILES of 5-Bromo-2-methyl-2-pentene?

The canonical SMILES of 5-Bromo-2-methyl-2-pentene is CC(=CCCBr)C.

What is the CAS number of 5-Bromo-2-methyl-2-pentene?

The CAS number of 5-Bromo-2-methyl-2-pentene is 2270-59-9.

What is the XLogP3-AA value of 5-Bromo-2-methyl-2-pentene?

The XLogP3-AA value of 5-Bromo-2-methyl-2-pentene is 2.9.

How many hydrogen bond donor counts does 5-Bromo-2-methyl-2-pentene have?

5-Bromo-2-methyl-2-pentene has 0 hydrogen bond donor counts.

How many rotatable bond counts does 5-Bromo-2-methyl-2-pentene have?

5-Bromo-2-methyl-2-pentene has 2 rotatable bond counts.

Please kindly note that our products and services are for research use only.