5-Bromo-1,10-phenanthroline hydrate

Catalog Number	ACM855360860
CAS	855360-86-0
Synonyms	5-Bromo-1,10-phenanthroline Monohydrate
IUPAC Name	5-bromo-1,10-phenanthroline;hydrate
Molecular Weight	277.12
Molecular Formula	C12H9BrN2O
InChI	VTTKUSYSKOIISY-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H7BrN2.H2O/c13-10-7-8-3-1-5-14-11(8)12-9(10)4-2-6-15-12;/h1-7H;1H2
Purity	95%
Isomeric SMILES	C1=CC2=CC(=C3C=CC=NC3=C2N=C1)Br.O

Q&A

What is the molecular weight of 5-Bromo-1,10-phenanthroline hydrate?

The molecular weight of 5-Bromo-1,10-phenanthroline hydrate is 277.11666.

What is the product name of 5-Bromo-1,10-phenanthroline Monohydrate?

The product name of 5-Bromo-1,10-phenanthroline Monohydrate is 5-Bromo-1,10-phenanthroline Monohydrate.

What are some synonyms for 5-Bromo-1,10-phenanthroline Monohydrate?

Some synonyms for 5-Bromo-1,10-phenanthroline Monohydrate are 5-Bromo-1,10-phenanthroline hydrate and 5-Bromo-110-phenanthrolinemonohydrate.

What is the molecular formula of 5-Bromo-1,10-phenanthroline Monohydrate?

The molecular formula of 5-Bromo-1,10-phenanthroline Monohydrate is C12H9BrN2O.

What is the EINECS number of 5-Bromo-1,10-phenanthroline hydrate?

The EINECS number of 5-Bromo-1,10-phenanthroline hydrate is 254-742-7.

How should 5-Bromo-1,10-phenanthroline hydrate be stored?

5-Bromo-1,10-phenanthroline hydrate should be sealed in dry conditions at room temperature for storage.

What is the chemical structure of 5-Bromo-1,10-phenanthroline hydrate?

The chemical structure of 5-Bromo-1,10-phenanthroline hydrate consists of a phenanthroline ring with a bromine atom attached.

Is 5-Bromo-1,10-phenanthroline Monohydrate soluble in water?

5-Bromo-1,10-phenanthroline Monohydrate has limited solubility in water.

What are some potential uses of 5-Bromo-1,10-phenanthroline Monohydrate?

5-Bromo-1,10-phenanthroline Monohydrate can be used as a ligand in coordination chemistry and in various chemical reactions.

How is 5-Bromo-1,10-phenanthroline Monohydrate typically synthesized?

5-Bromo-1,10-phenanthroline Monohydrate is typically synthesized through bromination of 1,10-phenanthroline under controlled conditions.