What is the molecular formula of 5,10,15,20-Tetraphenyl-21H,23H-porphine vanadium(IV) oxide?
The molecular formula is C44H28N4OV.
What is the PubChem CID of 5,10,15,20-Tetraphenyl-21H,23H-porphine vanadium(IV) oxide?
The PubChem CID is 2733357.
What is the molecular weight of 5,10,15,20-Tetraphenyl-21H,23H-porphine vanadium(IV) oxide?
The molecular weight is 679.7 g/mol.
What is the IUPAC name of 5,10,15,20-Tetraphenyl-21H,23H-porphine vanadium(IV) oxide?
The IUPAC name is oxovanadium(2+);5,10,15,20-tetraphenylporphyrin-22,24-diide.
What is the InChI key of 5,10,15,20-Tetraphenyl-21H,23H-porphine vanadium(IV) oxide?
The InChI key is WDCQRRQLLCXEFB-UHFFFAOYSA-N.
What is the canonical SMILES of 5,10,15,20-Tetraphenyl-21H,23H-porphine vanadium(IV) oxide?
The canonical SMILES is C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C=C4)C9=CC=CC=C9)[N-]3.O=[V+2].
What is the hydrogen bond donor count of 5,10,15,20-Tetraphenyl-21H,23H-porphine vanadium(IV) oxide?
The hydrogen bond donor count is 0.
What is the hydrogen bond acceptor count of 5,10,15,20-Tetraphenyl-21H,23H-porphine vanadium(IV) oxide?
The hydrogen bond acceptor count is 5.
What is the rotatable bond count of 5,10,15,20-Tetraphenyl-21H,23H-porphine vanadium(IV) oxide?
The rotatable bond count is 4.
Is 5,10,15,20-Tetraphenyl-21H,23H-porphine vanadium(IV) oxide a canonicalized compound?
Yes, it is a canonicalized compound.