ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

5,10,15,20-Tetrakis(3-methoxyphenyl)porphyrinatonickel

Catalog Number ACM24249307
CAS 24249-30-7
Synonyms Cupper(II) meso-tetra (4-methoxyphenyl) porphine
Molecular Weight 796.39
Molecular Formula C48H36CuN4O4
Canonical SMILES COC1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=C(C=C7)OC)C8=CC=C(C=C8)OC)C=C4)C9=CC=C(C=C9)OC)[N-]3.[Cu+2]
InChI InChI=1S/C48H36N4O4.Cu/c1-53-33-13-5-29(6-14-33)45-37-21-23-39(49-37)46(30-7-15-34(54-2)16-8-30)41-25-27-43(51-41)48(32-11-19-36(56-4)20-12-32)44-28-26-42(52-44)47(40-24-22-38(45)50-40)31-9-17-35(55-3)18-10-31;/h5-28H,1-4H3;/q-2;+2
InChI Key SRXJYJQOZHEHQG-UHFFFAOYSA-N
Purity 97%
Complexity 986
Covalently-Bonded Unit Count 2
Defined Atom Stereocenter Count 0
Exact Mass 795.203253
Heavy Atom Count 57
Hydrogen Bond Acceptor Count 8
Hydrogen Bond Donor Count 0
Monoisotopic Mass 795.203253
Rotatable Bond Count 8
Topological Polar Surface Area 64.7 Ų
Q&A

What is the molecular weight of 5,10,15,20-Tetrakis(3-methoxyphenyl)porphyrinatonickel?

The molecular weight is 796.39.

How is 5,10,15,20-Tetrakis(3-methoxyphenyl)porphyrinatonickel stored?

It is stored under inert gas (nitrogen or argon) at 2-8°C.

What are the synonyms for 5,10,15,20-Tetrakis(3-methoxyphenyl)porphyrinatonickel?

Some synonyms include Cu(II) meso-Tetra (4-methoxyphenyl) Porphine, Cu(II) tetramethoxyphenylporphyrin, and meso-Tera(4-methoxyphenyl)porphyrin-Cu(II).

What is the chemical formula for 5,10,15,20-Tetrakis(3-methoxyphenyl)porphyrinatonickel?

The chemical formula is C48H36CuN4O4.

What is the CAS number for 5,10,15,20-Tetrakis(3-methoxyphenyl)porphyrinatonickel?

The CAS number is 24249-30-7.

What is the recommended temperature range for storing this compound?

It is recommended to store it at 2-8°C.

Are there any specific storage conditions mentioned for 5,10,15,20-Tetrakis(3-methoxyphenyl)porphyrinatonickel?

It should be stored under inert gas such as nitrogen or argon.

How many nitrogen atoms are present in the chemical formula of 5,10,15,20-Tetrakis(3-methoxyphenyl)porphyrinatonickel?

There are 4 nitrogen atoms.

What is the recommended storage method to prevent degradation of 5,10,15,20-Tetrakis(3-methoxyphenyl)porphyrinatonickel?

Storing it under inert gas can prevent degradation.

Which metal is present in the porphyrin structure of 5,10,15,20-Tetrakis(3-methoxyphenyl)porphyrinatonickel?

Nickel is the metal present in the porphyrin structure.

Please kindly note that our products and services are for research use only.