What is the CAS number for 4-Hydroxy-2,6-dimethyldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine 4-oxide?
The CAS number is 65355-16-0.
What is the molecular formula of 4-Hydroxy-2,6-dimethyldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine 4-oxide?
The molecular formula is C22H17O4P.
What is the computed properties complexity of this compound?
The complexity is 561.
How many hydrogen bond acceptors does the compound have?
It has 4 hydrogen bond acceptors.
What is the IUPAC name of 4-Hydroxy-2,6-dimethyldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine 4-oxide?
The IUPAC name is 13-hydroxy-10,16-dimethyl-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide.
What is the molecular weight of this compound?
The molecular weight is 376.3g/mol.
What is the Canonical SMILES representation of 4-Hydroxy-2,6-dimethyldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine 4-oxide?
The Canonical SMILES is CC1=CC2=CC=CC=C2C3=C1OP(=O)(OC4=C3C5=CC=CC=C5C=C4C)O.
How many defined atom stereocenters does the compound have?
It has 0 defined atom stereocenters.
What is the XLogP3 value for this compound?
The XLogP3 value is 5.5.
What is the InChIKey for 4-Hydroxy-2,6-dimethyldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine 4-oxide?
The InChIKey is CPPHRGAOJUWAOZ-UHFFFAOYSA-N.