What is the molecular formula of 4,4'-Dinonyl-2,2'-bipyridyl?
The molecular formula of 4,4'-Dinonyl-2,2'-bipyridyl is C28H46N2.
What is the molecular weight of 4,4'-Dinonyl-2,2'-bipyridyl?
The molecular weight of 4,4'-Dinonyl-2,2'-bipyridyl is 410.7 g/mol.
What is the IUPAC name of 4,4'-Dinonyl-2,2'-bipyridyl?
The IUPAC name of 4,4'-Dinonyl-2,2'-bipyridyl is 4,4-di(nonyl)-2-pyridin-2-yl-3H-pyridine.
What is the InChI of 4,4'-Dinonyl-2,2'-bipyridyl?
The InChI of 4,4'-Dinonyl-2,2'-bipyridyl is InChI=1S/C28H46N2/c1-3-5-7-9-11-13-16-20-28(21-17-14-12-10-8-6-4-2)22-24-30-27(25-28)26-19-15-18-23-29-26/h15,18-19,22-24H,3-14,16-17,20-21,25H2,1-2H3.
What is the InChIKey of 4,4'-Dinonyl-2,2'-bipyridyl?
The InChIKey of 4,4'-Dinonyl-2,2'-bipyridyl is JLPLVIPEXNMWGC-UHFFFAOYSA-N.
What is the canonical SMILES of 4,4'-Dinonyl-2,2'-bipyridyl?
The canonical SMILES of 4,4'-Dinonyl-2,2'-bipyridyl is CCCCCCCCCC1(CC(=NC=C1)C2=CC=CC=N2)CCCCCCCCC.
What is the XLogP3-AA value of 4,4'-Dinonyl-2,2'-bipyridyl?
The XLogP3-AA value of 4,4'-Dinonyl-2,2'-bipyridyl is 11.
How many hydrogen bond donor count does 4,4'-Dinonyl-2,2'-bipyridyl have?
4,4'-Dinonyl-2,2'-bipyridyl does not have any hydrogen bond donor count.
How many hydrogen bond acceptor count does 4,4'-Dinonyl-2,2'-bipyridyl have?
4,4'-Dinonyl-2,2'-bipyridyl has 2 hydrogen bond acceptor count.
How many rotatable bond count does 4,4'-Dinonyl-2,2'-bipyridyl have?
4,4'-Dinonyl-2,2'-bipyridyl has 17 rotatable bond count.