What is the molecular formula of 3-(Diisopropylphosphanyl)propan-1-aminium tetrafluoroborate?
The molecular formula is C9H23BF4NP.
What is the exact mass of 3-(Diisopropylphosphanyl)propan-1-aminium tetrafluoroborate?
The exact mass is 263.1597295.
What is the IUPAC name of 3-(Diisopropylphosphanyl)propan-1-aminium tetrafluoroborate?
The IUPAC name is 3-di(propan-2-yl)phosphanylpropylazanium;tetrafluoroborate.
How many heavy atoms are present in 3-(Diisopropylphosphanyl)propan-1-aminium tetrafluoroborate?
There are 16 heavy atoms.
What is the topological polar surface area of 3-(Diisopropylphosphanyl)propan-1-aminium tetrafluoroborate?
The topological polar surface area is 27.6.
How many hydrogen bond acceptor counts are there in 3-(Diisopropylphosphanyl)propan-1-aminium tetrafluoroborate?
There are 5 hydrogen bond acceptors.
What is the canonical SMILES notation for 3-(Diisopropylphosphanyl)propan-1-aminium tetrafluoroborate?
[B-](F)(F)(F)F.CC(C)P(CCC[NH3+])C(C)C
What is the computed properties complexity of 3-(Diisopropylphosphanyl)propan-1-aminium tetrafluoroborate?
The computed properties complexity is 103.
How many covalently-bonded units are counted in 3-(Diisopropylphosphanyl)propan-1-aminium tetrafluoroborate?
There are 2 covalently-bonded units.
What is the molecular weight of 3-(Diisopropylphosphanyl)propan-1-aminium tetrafluoroborate?
The molecular weight is 263.07g/mol.
