3-(Di-tert-butylphosphanyl)propan-1-aminium tetrafluoroborate

Catalog Number	ACMA00041011
Molecular Weight	291.12
Molecular Formula	C11H27BF4NP
Purity	97%

Q&A

What is the exact mass of the compound 3-(Di-tert-butylphosphanyl)propan-1-aminium tetrafluoroborate?

The exact mass of the compound is 291.1910297.

What is the IUPAC Name of the compound?

The IUPAC Name of the compound is 3-ditert-butylphosphanylpropylazanium;tetrafluoroborate.

How many heavy atoms are present in the compound?

There are 18 heavy atoms present in the compound.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 27.6.

How many rotatable bonds are there in the compound?

There are 5 rotatable bonds in the compound.

What is the molecular weight of 3-(Di-tert-butylphosphanyl)propan-1-aminium tetrafluoroborate?

The molecular weight of the compound is 291.12g/mol.

What is the Canonical SMILES representation of the compound?

[B-](F)(F)(F)F.CC(C)(C)P(CCC[NH3+])C(C)(C)C

How many covalently-bonded units are present in the compound?

There are 2 covalently-bonded units present in the compound.

What is the InChIKey of the compound?

The InChIKey is RVDIKZBKDWDDJH-UHFFFAOYSA-O.