What is the molecular formula of 3,9-Perylenedicarboxylic acid?
The molecular formula of 3,9-Perylenedicarboxylic acid is C22H12O4.
What is the molecular weight of 3,9-Perylenedicarboxylic acid?
The molecular weight of 3,9-Perylenedicarboxylic acid is 340.3 g/mol.
When was 3,9-Perylenedicarboxylic acid created?
3,9-Perylenedicarboxylic acid was created on August 8, 2005.
What is the IUPAC name of 3,9-Perylenedicarboxylic acid?
The IUPAC name of 3,9-Perylenedicarboxylic acid is perylene-3,9-dicarboxylic acid.
What is the Canonical SMILES of 3,9-Perylenedicarboxylic acid?
The Canonical SMILES of 3,9-Perylenedicarboxylic acid is C1=CC2=C3C(=C1)C(=CC=C3C4=C5C2=CC=C(C5=CC=C4)C(=O)O)C(=O)O.
What is the CAS number of 3,9-Perylenedicarboxylic acid?
The CAS number of 3,9-Perylenedicarboxylic acid is 6364-19-8.
What is the European Community (EC) number of 3,9-Perylenedicarboxylic acid?
The European Community (EC) number of 3,9-Perylenedicarboxylic acid is 228-852-0.
What is the XLogP3-AA value of 3,9-Perylenedicarboxylic acid?
The XLogP3-AA value of 3,9-Perylenedicarboxylic acid is 4.8.
How many hydrogen bond donor counts does 3,9-Perylenedicarboxylic acid have?
3,9-Perylenedicarboxylic acid has 2 hydrogen bond donor counts.
Is 3,9-Perylenedicarboxylic acid a canonicalized compound?
Yes, 3,9-Perylenedicarboxylic acid is a canonicalized compound.
