ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

3,9-Perylenedicarboxylic acid

Catalog Number ACM6364198-3
CAS 6364-19-8
Structure {[CurrentData.Name]}
Synonyms Perylene-3,9-Dicarboxylic Acid
Molecular Weight 340.33
Molecular Formula C22H12O4
Purity 95%
Appearance Red brown powder
Q&A

What is the molecular formula of 3,9-Perylenedicarboxylic acid?

The molecular formula of 3,9-Perylenedicarboxylic acid is C22H12O4.

What is the molecular weight of 3,9-Perylenedicarboxylic acid?

The molecular weight of 3,9-Perylenedicarboxylic acid is 340.3 g/mol.

When was 3,9-Perylenedicarboxylic acid created?

3,9-Perylenedicarboxylic acid was created on August 8, 2005.

What is the IUPAC name of 3,9-Perylenedicarboxylic acid?

The IUPAC name of 3,9-Perylenedicarboxylic acid is perylene-3,9-dicarboxylic acid.

What is the Canonical SMILES of 3,9-Perylenedicarboxylic acid?

The Canonical SMILES of 3,9-Perylenedicarboxylic acid is C1=CC2=C3C(=C1)C(=CC=C3C4=C5C2=CC=C(C5=CC=C4)C(=O)O)C(=O)O.

What is the CAS number of 3,9-Perylenedicarboxylic acid?

The CAS number of 3,9-Perylenedicarboxylic acid is 6364-19-8.

What is the European Community (EC) number of 3,9-Perylenedicarboxylic acid?

The European Community (EC) number of 3,9-Perylenedicarboxylic acid is 228-852-0.

What is the XLogP3-AA value of 3,9-Perylenedicarboxylic acid?

The XLogP3-AA value of 3,9-Perylenedicarboxylic acid is 4.8.

How many hydrogen bond donor counts does 3,9-Perylenedicarboxylic acid have?

3,9-Perylenedicarboxylic acid has 2 hydrogen bond donor counts.

Is 3,9-Perylenedicarboxylic acid a canonicalized compound?

Yes, 3,9-Perylenedicarboxylic acid is a canonicalized compound.

Please kindly note that our products and services are for research use only.