ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

3,8-(Dithiophen-2-yl)-1,10-phenanthroline

Catalog Number ACM753491326-1
CAS 753491-32-6
Structure {[CurrentData.Name]}
Synonyms 3,8-Di(thien-2-yl)-1,10-phenanthroline
IUPAC Name 3,8-dithiophen-2-yl-1,10-phenanthroline
Molecular Weight 344.45
Molecular Formula C20H12N2S2
InChI KZXODWQOXSIVDW-UHFFFAOYSA-N
InChI Key InChI=1S/C20H12N2S2/c1-3-17(23-7-1)15-9-13-5-6-14-10-16(18-4-2-8-24-18)12-22-20(14)19(13)21-11-15/h1-12H
Purity 95%+
Isomeric SMILES C1=CSC(=C1)C2=CN=C3C(=C2)C=CC4=CC(=CN=C43)C5=CC=CS5
Q&A

What is the molecular weight of 3,8-Di(thien-2-yl)-1,10-phenanthroline?

The molecular weight of 3,8-Di(thien-2-yl)-1,10-phenanthroline is 344.45.

What are the synonyms for 3,8-Di(thien-2-yl)-1,10-phenanthroline?

The synonyms for 3,8-Di(thien-2-yl)-1,10-phenanthroline are 3,8-(dithiophen-2-yl)-1,10-phenanthroline 97%, and 3,8-Di(thien-2-yl)-1,10-phenanthroline 97%.

What is the molecular formula of 3,8-Di(thien-2-yl)-1,10-phenanthroline?

The molecular formula of 3,8-Di(thien-2-yl)-1,10-phenanthroline is C20H12N2S2.

What is the EINECS number of 3,8-Di(thien-2-yl)-1,10-phenanthroline?

The EINECS number of 3,8-Di(thien-2-yl)-1,10-phenanthroline is 1312995-182-4.

What is the predicted boiling point of 3,8-Di(thien-2-yl)-1,10-phenanthroline?

The predicted boiling point of 3,8-Di(thien-2-yl)-1,10-phenanthroline is 549.2±45.0 °C.

What is the recommended storage temperature for 3,8-Di(thien-2-yl)-1,10-phenanthroline?

The recommended storage temperature for 3,8-Di(thien-2-yl)-1,10-phenanthroline is 2-8°C.

What is the density of 3,8-Di(thien-2-yl)-1,10-phenanthroline?

The density of 3,8-Di(thien-2-yl)-1,10-phenanthroline is 1.358.

What is the pKa value of 3,8-Di(thien-2-yl)-1,10-phenanthroline?

The pKa value of 3,8-Di(thien-2-yl)-1,10-phenanthroline is 4.71±0.10 (Predicted).

How many sulfur atoms are present in the molecular formula of 3,8-Di(thien-2-yl)-1,10-phenanthroline?

There are two sulfur atoms present in the molecular formula of 3,8-Di(thien-2-yl)-1,10-phenanthroline.

What is the percentage purity of 3,8-(Dithiophen-2-yl)-1,10-phenanthroline in one synonym?

The percentage purity of 3,8-(Dithiophen-2-yl)-1,10-phenanthroline in one synonym is 97%.

Please kindly note that our products and services are for research use only.