ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

3,8-Di(9H-carbazol-9-yl)-1,10-phenanthroline

Catalog Number ACM796847411
CAS 796847-41-1
Synonyms 3,8-Di(Carbazol-9-Yl)-1,10-Phenanthroline
IUPAC Name 3,8-di(carbazol-9-yl)-1,10-phenanthroline
Molecular Weight 510.59
Molecular Formula C36H22N4
InChI KDAGMMCQENYLIS-UHFFFAOYSA-N
InChI Key InChI=1S/C36H22N4/c1-5-13-31-27(9-1)28-10-2-6-14-32(28)39(31)25-19-23-17-18-24-20-26(22-38-36(24)35(23)37-21-25)40-33-15-7-3-11-29(33)30-12-4-8-16-34(30)40/h1-22H
Purity 98%
Isomeric SMILES C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CN=C5C(=C4)C=CC6=CC(=CN=C65)N7C8=CC=CC=C8C9=CC=CC=C97
Q&A

What is the chemical formula for 3,8-Di(9H-carbazol-9-yl)-1,10-phenanthroline?

The chemical formula is C36H22N4.

What is the molecular weight of 3,8-Di(9H-carbazol-9-yl)-1,10-phenanthroline?

The molecular weight is 510.59.

What is another name for 3,8-Di(9H-carbazol-9-yl)-1,10-phenanthroline?

Another name is 1,10-Phenanthroline, 3,8-di-9H-carbazol-9-yl-.

How many carbons are present in the chemical structure of 3,8-Di(9H-carbazol-9-yl)-1,10-phenanthroline?

There are 36 carbon atoms.

How many nitrogen atoms are present in the MF of 3,8-Di(9H-carbazol-9-yl)-1,10-phenanthroline?

There are 4 nitrogen atoms.

What is the CAS number for 3,8-Di(9H-carbazol-9-yl)-1,10-phenanthroline?

The CAS number is 796847-41-1.

How many phenanthroline rings are present in the chemical structure of 3,8-Di(9H-carbazol-9-yl)-1,10-phenanthroline?

There is one phenanthroline ring.

What is the molecular formula of 3,8-Di(9H-carbazol-9-yl)-1,10-phenanthroline?

The molecular formula is C36H22N4.

Please kindly note that our products and services are for research use only.