ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

3,3',5,5'-Tetrachloro-2,2'-bipyridine

Catalog Number ACM100846284
CAS 100846-28-4
Synonyms 3,5-Dichloro-2-(3,5-dichloropyridin-2-yl)pyridine
IUPAC Name 3,5-dichloro-2-(3,5-dichloropyridin-2-yl)pyridine
Molecular Weight 293.96
Molecular Formula C10H4Cl4N2
InChI LBWLQILBBQSTFR-UHFFFAOYSA-N
InChI Key InChI=1S/C10H4Cl4N2/c11-5-1-7(13)9(15-3-5)10-8(14)2-6(12)4-16-10/h1-4H
Boiling Point 325.0±37.0 °C(Predicted)
Purity 98%
Isomeric SMILES C1=C(C=NC(=C1Cl)C2=C(C=C(C=N2)Cl)Cl)Cl
Q&A

What is the molecular weight of 3,3',5,5'-Tetrachloro-2,2'-bipyridine?

The molecular weight of 3,3',5,5'-Tetrachloro-2,2'-bipyridine is 293.96.

What are some synonyms for 3,3',5,5'-Tetrachloro-2,2'-bipyridine?

Some synonyms for 3,3',5,5'-Tetrachloro-2,2'-bipyridine are 2,2'-Bipyridine, 3,3',5,5'-tetrachloro- and 3,3',5,5'-Tetrachloro-2,2'-bipyridine.

What is the molecular formula of 3,3',5,5'-Tetrachloro-2,2'-bipyridine?

The molecular formula of 3,3',5,5'-Tetrachloro-2,2'-bipyridine is C10H4Cl4N2.

What is the predicted boiling point of 3,3',5,5'-Tetrachloro-2,2'-bipyridine?

The predicted boiling point of 3,3',5,5'-Tetrachloro-2,2'-bipyridine is 325.0±37.0 °C.

What is the predicted pka value of 3,3',5,5'-Tetrachloro-2,2'-bipyridine?

The predicted pka value of 3,3',5,5'-Tetrachloro-2,2'-bipyridine is -0.75±0.30.

What is the predicted density of 3,3',5,5'-Tetrachloro-2,2'-bipyridine?

The predicted density of 3,3',5,5'-Tetrachloro-2,2'-bipyridine is 1.555±0.06 g/cm3.

What is the CAS number of 3,3',5,5'-Tetrachloro-2,2'-bipyridine?

The CAS number of 3,3',5,5'-Tetrachloro-2,2'-bipyridine is 100846-28-4.

Please kindly note that our products and services are for research use only.