3,3',3''-Phosphinetriyltris(propan-1-ol)

Catalog Number	ACM4706176-1
CAS	4706-17-6
Structure
Synonyms	Tris(hydroxypropyl)phosphine; THPP
IUPAC Name	3-[bis(3-hydroxypropyl)phosphanyl]propan-1-ol
Molecular Weight	208.24
Molecular Formula	C9H21O3P
InChI	YICAEXQYKBMDNH-UHFFFAOYSA-N
InChI Key	InChI=1S/C9H21O3P/c10-4-1-7-13(8-2-5-11)9-3-6-12/h10-12H,1-9H2
Boiling Point	196-198 °C(Press: 1 Torr)
Flash Point	>110 °C
Purity	80%+
Density	1.136 g/mL at 25 °C
Appearance	Liquid
Isomeric SMILES	C(CO)CP(CCCO)CCCO

Q&A

What is the IUPAC name of 3,3',3''-Phosphinetriyltris(propan-1-ol)?

The IUPAC name of 3,3',3''-Phosphinetriyltris(propan-1-ol) is 3-[bis(3-hydroxypropyl)phosphanyl]propan-1-ol.

What is the European Community (EC) Number of 3,3',3''-Phosphinetriyltris(propan-1-ol)?

The European Community (EC) Number of 3,3',3''-Phosphinetriyltris(propan-1-ol) is 803-871-2.

What is the exact mass of 3,3',3''-Phosphinetriyltris(propan-1-ol)?

The exact mass of 3,3',3''-Phosphinetriyltris(propan-1-ol) is 208.12283153.

How many heavy atoms are present in 3,3',3''-Phosphinetriyltris(propan-1-ol)?

There are 13 heavy atoms present in 3,3',3''-Phosphinetriyltris(propan-1-ol).

What is the molecular weight of 3,3',3''-Phosphinetriyltris(propan-1-ol)?

The molecular weight of 3,3',3''-Phosphinetriyltris(propan-1-ol) is 208.23g/mol.

How many hydrogen bond acceptors are present in 3,3',3''-Phosphinetriyltris(propan-1-ol)?

There are 3 hydrogen bond acceptors present in 3,3',3''-Phosphinetriyltris(propan-1-ol).

How many hydrogen bond donors are present in 3,3',3''-Phosphinetriyltris(propan-1-ol)?

There are 3 hydrogen bond donors present in 3,3',3''-Phosphinetriyltris(propan-1-ol).

What is the computed properties XLogP3 value of 3,3',3''-Phosphinetriyltris(propan-1-ol)?

The computed properties XLogP3 value of 3,3',3''-Phosphinetriyltris(propan-1-ol) is -1.

What are some of the depositor-supplied synonyms of 3,3',3''-Phosphinetriyltris(propan-1-ol)?

Some depositor-supplied synonyms of 3,3',3''-Phosphinetriyltris(propan-1-ol) include Tris(hydroxypropyl)phosphine, 3,3',3''-Phosphinetriyltris(propan-1-ol), and tris(3-hydroxypropyl) phosphine.

What is the Canonical SMILES representation of 3,3',3''-Phosphinetriyltris(propan-1-ol)?

The Canonical SMILES representation of 3,3',3''-Phosphinetriyltris(propan-1-ol) is C(CO)CP(CCCO)CCCO.