3-((2,6-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)pyridin-4-yl)oxy)propan-1-ol

Catalog Number	ACM1303995552
CAS	1303995-55-2
Synonyms	3-[2,6-Bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)pyridin-4-yl]oxypropan-1-ol
IUPAC Name	3-[2,6-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)pyridin-4-yl]oxypropan-1-ol
Molecular Weight	347.41
Molecular Formula	C18H25N3O4
InChI	NNIGYLCFLDQXFA-UHFFFAOYSA-N
InChI Key	InChI=1S/C18H25N3O4/c1-17(2)10-24-15(20-17)13-8-12(23-7-5-6-22)9-14(19-13)16-21-18(3,4)11-25-16/h8-9,22H,5-7,10-11H2,1-4H3
Purity	98%
Isomeric SMILES	CC1(COC(=N1)C2=CC(=CC(=N2)C3=NC(CO3)(C)C)OCCCO)C

Q&A

What is the CAS number of the compound?

The CAS number of the compound is 1303995-55-2.

What is the molecular weight of the compound?

The molecular weight of the compound is 347.41.

What is the product name of the compound?

The product name of the compound is 1-Propanol, 3-[[2,6-bis(4,5-dihydro-4,4-dimethyl-2-oxazolyl)-4-pyridinyl]oxy]-.

What are some synonyms of the compound?

Some synonyms of the compound are 1-Propanol, 3-[[2,6-bis(4,5-dihydro-4,4-dimethyl-2-oxazolyl)-4-pyridinyl]oxy]- and 3-((2,6-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)pyridin-4-yl)oxy)propan-1-ol.

What is the molecular formula of the compound?

The molecular formula of the compound is C18H25N3O4.

What is the melting point of the compound?

The melting point of the compound is 93-94 °C.

What is the predicted density of the compound?

The predicted density of the compound is 1.26±0.1 g/cm3.

What is the predicted boiling point of the compound?

The predicted boiling point of the compound is 534.9±50.0 °C.

What is the predicted pka value of the compound?

The predicted pka value of the compound is 14.67±0.10.

What is the structure of the compound?

The compound has a structure of 3-((2,6-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)pyridin-4-yl)oxy)propan-1-ol.