| Catalog Number |
ACM77876392 |
| CAS |
77876-39-2 |
| Structure |
 |
| Description |
(2S,4S)-(-)-2,4-Bis(diphenylphosphino)pentane, or (2S,4S)-(-)-DPP for short, is an organophosphorus compound with a variety of applications in chemical synthesis and scientific research. It is a chiral ligand, meaning it is able to form a complex with a metal atom, and is useful in asymmetric synthesis. It is also used in a variety of biological, biochemical, and physiological studies, including those related to drug development. This paper will discuss the synthesis of (2S,4S)-(-)-DPP, its scientific research applications, and its mechanism of action, biochemical and physiological effects, advantages and limitations for lab experiments, and potential future directions. |
| Synonyms |
[(1S,3S)-1,3-Dimethyl-1,3-propanediyl]bis[diphenylphosphine]; (S,S)-BDPP |
| IUPAC Name |
[(2S,4S)-4-diphenylphosphanylpentan-2-yl]-diphenylphosphane |
| Molecular Weight |
440.5 g/mol |
| Molecular Formula |
C29H30P2 |
| Canonical SMILES |
CC(CC(C)P(C1=CC=CC=C1)C2=CC=CC=C2)P(C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI |
InChI=1S/C29H30P2/c1-24(30(26-15-7-3-8-16-26)27-17-9-4-10-18-27)23-25(2)31(28-19-11-5-12-20-28)29-21-13-6-14-22-29/h3-22,24-25H,23H2,1-2H3/t24-,25-/m0/s1 |
| InChI Key |
CTYPJIUQROQJBG-DQEYMECFSA-N |
| Boiling Point |
543.8±33.0 °C(Predicted) |
| Melting Point |
81 °C |
| Flash Point |
300.7ºC |
| Purity |
98% |
| Appearance |
Solid |
| Application |
((2S,4S)-(-)-2,4-Bis(diphenylphosphino)pentane)-(-)-DPP has a variety of applications in scientific research. It is used as a ligand in asymmetric synthesis, allowing the formation of enantiomerically pure compounds. It is also used in studies related to drug development, as it can be used to form complexes with metal ions that can be used to study the interactions between drugs and their target molecules. In addition, it is used in studies related to the structure and reactivity of organophosphorus compounds, as well as studies related to the structure and reactivity of transition metal complexes. |
| Common Name |
(S,S)-BDPP |
| Exact Mass |
440.18200 |
| Isomeric SMILES |
C[C@@H](C[C@H](C)P(C1=CC=CC=C1)C2=CC=CC=C2)P(C3=CC=CC=C3)C4=CC=CC=C4 |
| Properties |
((2S,4S)-(-)-2,4-Bis(diphenylphosphino)pentane)-(-)-DPP has no known biochemical or physiological effects. It is used as a ligand to form complexes with metal ions, which can then be used to study the interactions between drugs and their target molecules. However, it does not interact with the target molecules directly, and so does not have any direct biochemical or physiological effects. |
| Type |
Chiral Ligands |
