2-Phenylquinoline

Catalog Number	ACM612964-1
CAS	612-96-4
Structure
Synonyms	Quinoline, 2-Phenyl-
IUPAC Name	2-phenylquinoline
Molecular Weight	205.25
Molecular Formula	C15H11N
Canonical SMILES	C1=CC=C(C=C1)C2=NC3=CC=CC=C3C=C2
InChI	FSEXLNMNADBYJU-UHFFFAOYSA-N
InChI Key	InChI=1S/C15H11N/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15/h1-11H
Boiling Point	363.0 °C
Melting Point	84-85 °C-lit.
Purity	99%
Appearance	White powder
Complexity	220
Covalently-Bonded Unit Count	1
EC Number	210-326-7
Exact Mass	205.089149g/mol
Formal Charge	0
Heavy Atom Count	16
Isomeric SMILES	C1=CC=C(C=C1)C2=NC3=CC=CC=C3C=C2
Monoisotopic Mass	205.089149g/mol
Rotatable Bond Count	1

Q&A

What is the molecular weight of 2-Phenylquinoline?

The molecular weight of 2-Phenylquinoline is 205.25.

What are the synonyms for 2-Phenylquinoline?

The synonyms for 2-Phenylquinoline include alpha-Phenylquinoline and a-Phenylquinoline.

What is the melting point of 2-Phenylquinoline?

The melting point of 2-Phenylquinoline is 84-85 °C.

What is the water solubility of 2-Phenylquinoline?

2-Phenylquinoline is slightly soluble in water.

What is the boiling point of 2-Phenylquinoline?

The boiling point of 2-Phenylquinoline is 363 °C.

What is the color of 2-Phenylquinoline?

2-Phenylquinoline is white to light yellow in color.

What is the hazard code for 2-Phenylquinoline?

The hazard code for 2-Phenylquinoline is Xi.

What is the description of 2-Phenylquinoline?

2-Phenylquinoline is the major quinoline alkaloid of Galipea iongiflora, a Bolivian plant used for treatment against cutaneous leishmaniasis.

How is 2-Phenylquinoline used in quantitative structure-activity relationship (QSAR) analyses?

2-Phenylquinoline is used in QSAR analyses of estrogen receptor β-selective ligands.

What is the synthesis reference for 2-Phenylquinoline?

Quinoline (1.0 g, 7.742 mmol) and phenyl lithium (2.30 mL, 2 M, 23.22 mmol) were reacted according to general procedure. Purification of the residue by silica gel column chromatography (EtOAc:MeOH:Et3N; 10-30:1:1 or PhMe:MeOH:Et3N; 10:1:1) gave 2-phenylquinoline (0.66 g, 42%) as an orange solid.Aniline (0.140 g, 1.50 mmol) and cinnamaldehyde (0.132 g, 1.00 mmol) were dissolved in toluene in a reaction vial equipped with a magnetic stirrer bar, followed by the addition of K10 (0.50 g). The reaction mixture was heated at a temperature of 110 °C for 3 hours. After completion of the reaction, the crude product was purified by column chromatography over silica gel eluting with a mixture of Hexane : Ethyl acetate (20:1) to produce 2-Phenylquinoline as a yellow solid (0.044 g, 21%).