What is the molecular formula of the compound 2-(Diphenylphosphino)-N,N-dimethylaniline?
The molecular formula is C20H20NP.
What is the exact mass of 2-(Diphenylphosphino)-N,N-dimethylaniline?
The exact mass is 305.133336640 g/mol.
How many heavy atoms are present in the compound?
There are 22 heavy atoms in the compound 2-(Diphenylphosphino)-N,N-dimethylaniline.
What is the computed value of XLogP3 for this compound?
The computed value of XLogP3 is 4.7 for 2-(Diphenylphosphino)-N,N-dimethylaniline.
How many rotatable bonds are present in the compound?
There are 4 rotatable bonds in 2-(Diphenylphosphino)-N,N-dimethylaniline.
What is the Canonical SMILES representation of the compound?
The Canonical SMILES representation is CN(C)C1=CC=CC=C1P(C2=CC=CC=C2)C3=CC=CC=C3.
What is the InChIKey of 2-(Diphenylphosphino)-N,N-dimethylaniline?
The InChIKey is LRZUEXVJCUCZCM-UHFFFAOYSA-N.
How many hydrogen bond acceptors are present in the molecule?
There is 1 hydrogen bond acceptor in 2-(Diphenylphosphino)-N,N-dimethylaniline.
What is the CAS number of the compound?
The CAS number is 4358-50-3.
How would you write the IUPAC name for this compound?
The IUPAC name is 2-diphenylphosphanyl-N,N-dimethylaniline.