2-(Diphenylphosphino)benzenesulfonic acid

Catalog Number	ACM111864256
CAS	111864-25-6
Synonyms	Diphenylphosphinobenzene Sulfonic Acid
IUPAC Name	2-diphenylphosphanylbenzenesulfonic acid
Molecular Weight	342.35
Molecular Formula	C18H15O3PS
InChI	HXVJDHROZFWXHT-UHFFFAOYSA-N
InChI Key	InChI=1S/C18H15O3PS/c19-23(20,21)18-14-8-7-13-17(18)22(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H,(H,19,20,21)
Melting Point	255-260 °C
Purity	98%
Appearance	Solid
Isomeric SMILES	C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3S(=O)(=O)O

Q&A

What is the Monoisotopic Mass of the compound "2-(Diphenylphosphino)benzenesulfonic acid"?

342.04795251

What is the InChIKey of the compound "2-(Diphenylphosphino)benzenesulfonic acid"?

HXVJDHROZFWXHT-UHFFFAOYSA-N

What is the CAS number of the compound "2-(Diphenylphosphino)benzenesulfonic acid"?

111864-25-6

What are the computed properties of the compound "2-(Diphenylphosphino)benzenesulfonic acid"?

Complexity: 443; Covalently-Bonded Unit Count: 1; Defined Atom Stereocenter Count: 0; Defined Bond Stereocenter Count: 0; Formal Charge: 0; Heavy Atom Count: 23; Hydrogen Bond Acceptor Count: 3; Hydrogen Bond Donor Count: 1; Isotope Atom Count: 0; Rotatable Bond Count: 4; Topological Polar Surface Area: 62.8; Undefined Atom Stereocenter Count: 0; Undefined Bond Stereocenter Count: 0; XLogP3: 3.4

What are some of the depositor-supplied synonyms for the compound "2-(Diphenylphosphino)benzenesulfonic acid"?

2-diphenylphosphanylbenzenesulfonic acid; 2-Sulfophenyldiphenylphosphine; Diphenylphosphinobenzene sulfonic acid

What is the IUPAC name of the compound "2-(Diphenylphosphino)benzenesulfonic acid"?

2-diphenylphosphanylbenzenesulfonic acid

What is the molecular formula of the compound "2-(Diphenylphosphino)benzenesulfonic acid"?

C18H15O3PS

What is the molecular weight of the compound "2-(Diphenylphosphino)benzenesulfonic acid"?

342.3g/mol