ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

(2-(Dimethylamino)ethyl)diphenylphosphine oxide

Catalog Number ACM24422557
CAS 24422-55-7
Synonyms 2-(Diphenylphosphoryl)-N,N-dimethylethanamine
IUPAC Name 2-diphenylphosphoryl-N,N-dimethylethanamine
Molecular Weight 273.31
Molecular Formula C16H20NOP
InChI WTFJMSFVGMRGBQ-UHFFFAOYSA-N
InChI Key InChI=1S/C16H20NOP/c1-17(2)13-14-19(18,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3
Purity 98%
Isomeric SMILES CN(C)CCP(=O)(C1=CC=CC=C1)C2=CC=CC=C2
Q&A

What is the CAS number of (2-(Dimethylamino)ethyl)diphenylphosphine oxide?

The CAS number is 24422-55-7.

What is the molecular formula of (2-(Dimethylamino)ethyl)diphenylphosphine oxide?

The molecular formula is C16H20NOP.

How many hydrogen bond acceptors does (2-(Dimethylamino)ethyl)diphenylphosphine oxide have?

It has 2 hydrogen bond acceptors.

What is the formal charge of (2-(Dimethylamino)ethyl)diphenylphosphine oxide?

The formal charge is 0.

What is the IUPAC name of (2-(Dimethylamino)ethyl)diphenylphosphine oxide?

The IUPAC name is 2-diphenylphosphoryl-N,N-dimethylethanamine.

What is the exact mass of (2-(Dimethylamino)ethyl)diphenylphosphine oxide?

The exact mass is 273.128251259.

How many heavy atoms does (2-(Dimethylamino)ethyl)diphenylphosphine oxide contain?

It contains 19 heavy atoms.

How many rotatable bonds does (2-(Dimethylamino)ethyl)diphenylphosphine oxide have?

It has 5 rotatable bonds.

What is the topological polar surface area of (2-(Dimethylamino)ethyl)diphenylphosphine oxide?

The topological polar surface area is 20.3.

What is the InChIKey of (2-(Dimethylamino)ethyl)diphenylphosphine oxide?

The InChIKey is WTFJMSFVGMRGBQ-UHFFFAOYSA-N.

Please kindly note that our products and services are for research use only.