(2-Di-tert-butylphosphinobiphenyl)gold(I) bis(trifluoromethanesulfonyl)imide

Catalog Number	ACM1036000948-1
CAS	1036000-94-8
Synonyms	Bis(trifluoromethylsulfonyl)azanide;ditert-butyl-(2-phenylphenyl)phosphanium;gold(1+)
Molecular Weight	776.5
Molecular Formula	C22H28AuF6NO4PS2
Canonical SMILES	CC(C)(C)[PH+](C1=CC=CC=C1C2=CC=CC=C2)C(C)(C)C.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[Au+]
InChI	InChI=1S/C20H27P.C2F6NO4S2.Au/c1-19(2,3)21(20(4,5)6)18-15-11-10-14-17(18)16-12-8-7-9-13-16;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/h7-15H,1-6H3;/q;-1;+1/p+1
InChI Key	IXAZMTRZKJUWDK-UHFFFAOYSA-O
Purity	98%
Complexity	856
Covalently-Bonded Unit Count	3
Defined Atom Stereocenter Count	0
Exact Mass	776.076727
Heavy Atom Count	37
Hydrogen Bond Acceptor Count	11
Hydrogen Bond Donor Count	0
Monoisotopic Mass	776.076727
Rotatable Bond Count	6
Topological Polar Surface Area	86 Ų

Q&A

What is the molecular weight of the compound with the CAS number 1036000-94-8?

The molecular weight is 776.52.

What is the product name of the compound with the CAS number 1036000-94-8?

The product name is JohnPhos AuNTf2.

What are some synonyms for the compound with the CAS number 1036000-94-8?

Some synonyms include (2-Biphenyl)(di-tert-butylphosphino)gold(I) bis(trifluoromethane)sulfonimide and 1,1'-Biphenyl]-2-ylbis(1,1-dimethylethyl)phosphine][1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamidato-κN]gold.

What is the melting point of the compound with the CAS number 1036000-94-8?

The melting point is 207-214°C.

What are the hazard codes associated with the compound with the CAS number 1036000-94-8?

The hazard code is Xi.

What are the safety statements for the compound with the CAS number 1036000-94-8?

The safety statement is 26.

What are the risk statements for the compound with the CAS number 1036000-94-8?

The risk statements are 36/37/38.

What is the WGK classification for the compound with the CAS number 1036000-94-8 in Germany?

The WGK classification is 3.

What is the chemical formula of the compound with the CAS number 1036000-94-8?

The chemical formula is C22H28AuF6NO4PS2.

What is the full name of the compound with the CAS number 1036000-94-8?

The full name is (2-Di-tert-butylphosphinobiphenyl)gold(I) bis(trifluoromethanesulfonyl)imide.