What is the molecular formula of 2'-(Di-tert-butylphosphino)acetophenone ethylene ketal?
The molecular formula is C18H29O2P.
What is the name of 2'-(Di-tert-butylphosphino)acetophenone ethylene ketal?
2'-(Di-tert-butylphosphino)acetophenone ethylene ketal is named Di-tert-butyl(2-(2-methyl-1,3-dioxolan-2-yl)phenyl)phosphine.
What is the exact mass of 2'-(Di-tert-butylphosphino)acetophenone ethylene ketal?
The exact mass is 308.19051716 g/mol.
What is the CAS number of 2'-(Di-tert-butylphosphino)acetophenone ethylene ketal?
The CAS number is 1202864-99-0.
How many hydrogen bond acceptors does 2'-(Di-tert-butylphosphino)acetophenone ethylene ketal have?
2'-(Di-tert-butylphosphino)acetophenone ethylene ketal has 2 hydrogen bond acceptors.
What is the Canonical SMILES of 2'-(Di-tert-butylphosphino)acetophenone ethylene ketal?
The Canonical SMILES is CC1(OCCO1)C2=CC=CC=C2P(C(C)(C)C)C(C)(C)C.
How many covalently-bonded units are in 2'-(Di-tert-butylphosphino)acetophenone ethylene ketal?
There is 1 covalently-bonded unit in 2'-(Di-tert-butylphosphino)acetophenone ethylene ketal.
What is the IUPAC name of 2'-(Di-tert-butylphosphino)acetophenone ethylene ketal?
The IUPAC name is ditert-butyl-[2-(2-methyl-1,3-dioxolan-2-yl)phenyl]phosphane.
What is the XLogP3 value of 2'-(Di-tert-butylphosphino)acetophenone ethylene ketal?
The XLogP3 value is 3.1.