2-Aminocyclohexanol

Catalog Number	ACM6850380-1
CAS	6850-38-0
Structure
Synonyms	1-Amino-2-hydroxycyclohexane
IUPAC Name	2-aminocyclohexan-1-ol
Molecular Weight	115.17
Molecular Formula	C6H13NO
InChI	PQMCFTMVQORYJC-UHFFFAOYSA-N
InChI Key	InChI=1S/C6H13NO/c7-5-3-1-2-4-6(5)8/h5-6,8H,1-4,7H2
Boiling Point	212°C at 760 mmHg
Purity	97%
Appearance	Solid
Isomeric SMILES	C1CCC(C(C1)N)O

Q&A

What is the molecular weight of 2-Aminocyclohexanol?

The molecular weight of 2-Aminocyclohexanol is 115.17.

What is the melting point of 2-Aminocyclohexanol?

The melting point of 2-Aminocyclohexanol is 65 °C.

In what form does 2-Aminocyclohexanol exist?

2-Aminocyclohexanol exists in powder to crystal form.

Is 2-Aminocyclohexanol soluble in Methanol?

Yes, 2-Aminocyclohexanol is soluble in Methanol.

What is the boiling point of 2-Aminocyclohexanol?

The boiling point of 2-Aminocyclohexanol is 212 °C.

How should 2-Aminocyclohexanol be stored?

2-Aminocyclohexanol should be kept in a dark place, in an inert atmosphere, at room temperature.

What is the Hazard Note associated with 2-Aminocyclohexanol?

The Hazard Note associated with 2-Aminocyclohexanol is Irritant.

What is the chemical formula of 2-Aminocyclohexanol?

The chemical formula of 2-Aminocyclohexanol is C6H13NO.

What is the HS Code for 2-Aminocyclohexanol?

The HS Code for 2-Aminocyclohexanol is 2922190090.

How is 2-Aminocyclohexanol synthesized?

2-Aminocyclohexanol is synthesized by adding ammonia water to a three-necked flask, and slowly dropping 1,2-epoxycyclohexane into the reaction flask under water bath reaction conditions.