2,9-Di-(2'-pyridyl)-1,10-phenanthroline

Catalog Number	ACM773883322
CAS	773883-32-2
Structure
Synonyms	2,9-Di(Pyridin-2-Yl)-1,10-Phenanthroline
IUPAC Name	2,9-dipyridin-2-yl-1,10-phenanthroline
Molecular Weight	334.37
Molecular Formula	C22H14N4
InChI	UAPZXFSSFAIVFA-UHFFFAOYSA-N
InChI Key	InChI=1S/C22H14N4/c1-3-13-23-17(5-1)19-11-9-15-7-8-16-10-12-20(18-6-2-4-14-24-18)26-22(16)21(15)25-19/h1-14H
Purity	98%
Isomeric SMILES	C1=CC=NC(=C1)C2=NC3=C(C=CC4=C3N=C(C=C4)C5=CC=CC=N5)C=C2

Q&A

What is the chemical name of the compound CAS:773883-32-2?

The chemical name is 2,9-Di-(2'-pyridyl)-1,10-phenanthroline.

What is the molecular weight of 2,9-Di-(2'-pyridyl)-1,10-phenanthroline?

The molecular weight is 334.37 g/mol.

What are some synonyms for 2,9-Di-(2'-pyridyl)-1,10-phenanthroline?

Some synonyms include 2,9-Di(pyridin-2-yl)-1,10-phenanthroline and 1,10-Phenanthroline, 2,9-di-2-pyridinyl-.

What is the molecular formula of 2,9-Di-(2'-pyridyl)-1,10-phenanthroline?

The molecular formula is C22H14N4.

How should 2,9-Di-(2'-pyridyl)-1,10-phenanthroline be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the CAS number of 2,9-Di-(2'-pyridyl)-1,10-phenanthroline?

The CAS number is 773883-32-2.

What is the recommended storage temperature for this compound?

The recommended storage temperature is 2-8°C.

Can 2,9-Di-(2'-pyridyl)-1,10-phenanthroline react with oxygen?

It is recommended to store it under inert gas to prevent reaction with oxygen.

Is 2,9-Di-(2'-pyridyl)-1,10-phenanthroline a solid, liquid, or gas at room temperature?

It is likely a solid at room temperature based on the storage instructions.

How many nitrogen atoms are present in the molecular formula of 2,9-Di-(2'-pyridyl)-1,10-phenanthroline?

There are four nitrogen atoms in the molecular formula.