2,6-Bis((R)-4-phenyl-4,5-dihydrooxazol-2-yl)pyridine

Catalog Number	ACM128249707-1
CAS	128249-70-7
Structure
Synonyms	2,6-Bis[(4R)-4-phenyl-2-oxazolinyl]pyridine; (+)-2,6-Bis[(4R)-4-phenyl-2-oxazolin-2-yl]pyridine
IUPAC Name	(4R)-4-phenyl-2-[6-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyridin-2-yl]-4,5-dihydro-1,3-oxazole
Molecular Weight	369.42
Molecular Formula	C23H19N3O2
Canonical SMILES	C1C(N=C(O1)C2=NC(=CC=C2)C3=NC(CO3)C4=CC=CC=C4)C5=CC=CC=C5
InChI	HLHBIMJNCKZZQO-SFTDATJTSA-N
InChI Key	InChI=1S/C23H19N3O2/c1-3-8-16(9-4-1)20-14-27-22(25-20)18-12-7-13-19(24-18)23-26-21(15-28-23)17-10-5-2-6-11-17/h1-13,20-21H,14-15H2/t20-,21-/m0/s1
Boiling Point	600.4±55.0 °C(Predicted)
Melting Point	171-175 °C-lit.
Purity	98%
Appearance	White crystalline
Exact Mass	369.147726857
Heavy Atom Count	28
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	0
Isomeric SMILES	C1[C@H](N=C(O1)C2=NC(=CC=C2)C3=N[C@@H](CO3)C4=CC=CC=C4)C5=CC=CC=C5
Monoisotopic Mass	369.147726857
Rotatable Bond Count	4
Topological Polar Surface Area	56.1 Ų

Q&A

What is the chemical formula of 2,6-Bis[(4R)-4-phenyl-2-oxazolinyl]pyridine?

The chemical formula is C23H19N3O2.

What is the molecular weight of 2,6-Bis[(4R)-4-phenyl-2-oxazolinyl]pyridine?

The molecular weight is 369.42.

What is the melting point of 2,6-Bis[(4R)-4-phenyl-2-oxazolinyl]pyridine?

The melting point is 171-175 °C.

What is the color of 2,6-Bis[(4R)-4-phenyl-2-oxazolinyl]pyridine?

The color is white.

What is the water solubility of 2,6-Bis[(4R)-4-phenyl-2-oxazolinyl]pyridine?

It is insoluble in water.

What are the Hazard Codes associated with 2,6-Bis[(4R)-4-phenyl-2-oxazolinyl]pyridine?

The Hazard Codes are Xi.

What are some of the reactions in which 2,6-Bis[(4R)-4-phenyl-2-oxazolinyl]pyridine is used as a ligand?

It is used as a ligand in the Copper catalyzed syn-selective Mukaiyama aldol reaction, Tin catalyzed anti-selective aldol reaction, Ytterbuim catalyzed desymmetrization of meso epoxides, and more.

What is the optical activity of 2,6-Bis[(4R)-4-phenyl-2-oxazolinyl]pyridine in methylene chloride?

The optical activity is [α]22/D 187°, c = 1 in methylene chloride.

What is the storage recommendation for 2,6-Bis[(4R)-4-phenyl-2-oxazolinyl]pyridine?

It should be stored in an Inert atmosphere at Room Temperature.

How is 2,6-Bis[(4R)-4-phenyl-2-oxazolinyl]pyridine used in the copper-catalyzed enantioselective arylation of N-arylated tetrahydroisoquinolines (THIQs)?

It is used as a chiral ligand in the process.