ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

2,6-Bis((R)-4-methyl-4,5-dihydrooxazol-2-yl)pyridine

Catalog Number ACM256377249
CAS 256377-24-9
Structure {[CurrentData.Name]}
Synonyms 2,6-Bis[(4R)-4,5-Dihydro-4-Methyl-2-Oxazolyl]Pyridine
IUPAC Name (4R)-4-methyl-2-[6-[(4R)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]pyridin-2-yl]-4,5-dihydro-1,3-oxazole
Molecular Weight 245.28
Molecular Formula C13H15N3O2
InChI UHXIDHCQNRFIHV-RKDXNWHRSA-N
InChI Key InChI=1S/C13H15N3O2/c1-8-6-17-12(14-8)10-4-3-5-11(16-10)13-15-9(2)7-18-13/h3-5,8-9H,6-7H2,1-2H3/t8-,9-/m1/s1
Boiling Point 428.5±30.0 °C(Predicted)
Purity 97%
Isomeric SMILES C[C@@H]1COC(=N1)C2=NC(=CC=C2)C3=N[C@@H](CO3)C
Q&A

What is the CAS number for 2,6-Bis((R)-4-methyl-4,5-dihydrooxazol-2-yl)pyridine?

CAS: 256377-24-9

What is the molecular weight of 2,6-Bis((R)-4-methyl-4,5-dihydrooxazol-2-yl)pyridine?

MW: 245.28

What are some synonyms for 2,6-Bis((R)-4-methyl-4,5-dihydrooxazol-2-yl)pyridine?

Some synonyms include 2,6-bis[(4R)-4,5-dihydro-4-methyl-2-oxazolyl]-Pyridine and (R,R)-Me-Pybox.

What is the molecular formula of 2,6-Bis((R)-4-methyl-4,5-dihydrooxazol-2-yl)pyridine?

MF: C13H15N3O2

What is the predicted boiling point of 2,6-Bis((R)-4-methyl-4,5-dihydrooxazol-2-yl)pyridine?

Boiling point: 428.5±30.0 °C (Predicted)

How should 2,6-Bis((R)-4-methyl-4,5-dihydrooxazol-2-yl)pyridine be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the predicted density of 2,6-Bis((R)-4-methyl-4,5-dihydrooxazol-2-yl)pyridine?

Density: 1.34±0.1 g/cm3 (Predicted)

What is the predicted pka of 2,6-Bis((R)-4-methyl-4,5-dihydrooxazol-2-yl)pyridine?

pka: 3.91±0.70 (Predicted)

How can the purity of 2,6-Bis((R)-4-methyl-4,5-dihydrooxazol-2-yl)pyridine be determined?

The purity can be determined by various analytical techniques such as HPLC, NMR, and MS.

What are some potential uses or applications of 2,6-Bis((R)-4-methyl-4,5-dihydrooxazol-2-yl)pyridine?

It is commonly used as a ligand in organometallic chemistry and catalysis, particularly in asymmetric synthesis reactions.

Please kindly note that our products and services are for research use only.