2,6-Bis((R)-4-benzyl-4,5-dihydrooxazol-2-yl)pyridine

Catalog Number	ACM365215389
CAS	365215-38-9
Structure
Synonyms	2,6-Bis[(4R)-benzyl-2-oxazolin-2-yl]pyridine
IUPAC Name	(4R)-4-benzyl-2-[6-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]pyridin-2-yl]-4,5-dihydro-1,3-oxazole
Molecular Weight	397.47
Molecular Formula	C25H23N3O2
InChI	ZBONTXCYJLVGLR-NHCUHLMSSA-N
InChI Key	InChI=1S/C25H23N3O2/c1-3-8-18(9-4-1)14-20-16-29-24(26-20)22-12-7-13-23(28-22)25-27-21(17-30-25)15-19-10-5-2-6-11-19/h1-13,20-21H,14-17H2/t20-,21-/m1/s1
Boiling Point	604.1±40.0 °C(Predicted)
Purity	95%
Appearance	White to light yellow powder
Isomeric SMILES	C1[C@H](N=C(O1)C2=NC(=CC=C2)C3=N[C@@H](CO3)CC4=CC=CC=C4)CC5=CC=CC=C5

Q&A

What is the molecular weight of 2,6-Bis((R)-4-benzyl-4,5-dihydrooxazol-2-yl)pyridine?

The molecular weight is 397.47.

What are some synonyms for 2,6-Bis((R)-4-benzyl-4,5-dihydrooxazol-2-yl)pyridine?

Synonyms include 2,6-Bis[(4R)-benzyl-2-oxazolin-2-yl]pyridine, (R,R)-Bn-Pybox, and more.

What is the boiling point of 2,6-Bis((R)-4-benzyl-4,5-dihydrooxazol-2-yl)pyridine?

The predicted boiling point is 604.1±40.0 °C.

How should 2,6-Bis((R)-4-benzyl-4,5-dihydrooxazol-2-yl)pyridine be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the form of 2,6-Bis((R)-4-benzyl-4,5-dihydrooxazol-2-yl)pyridine?

It is in powder form.

What is the density of 2,6-Bis((R)-4-benzyl-4,5-dihydrooxazol-2-yl)pyridine predicted to be?

The predicted density is 1.24±0.1 g/cm3.

What is the predicted pKa of 2,6-Bis((R)-4-benzyl-4,5-dihydrooxazol-2-yl)pyridine?

The predicted pKa is 3.85±0.70.

What color is 2,6-Bis((R)-4-benzyl-4,5-dihydrooxazol-2-yl)pyridine?

It is white to light-yellow in color.

Are there any specific risk statements associated with 2,6-Bis((R)-4-benzyl-4,5-dihydrooxazol-2-yl)pyridine?

Yes, the risk statements are 36/37/38.

How is 2,6-Bis((R)-4-benzyl-4,5-dihydrooxazol-2-yl)pyridine used in reactions?

It is used as a ligand for the Calcium-catalyzed asymmetric Mannich reaction of malonates with imines and the Scandium-catalyzed asymmetric dearomatization of 2-naphthols by electrophilic amination.