2,6-Bis(dimethylamino)-2'-bromo-1,1'-biphenyl

Catalog Number	ACM1160556637
CAS	1160556-63-7
Synonyms	2-(2-Bromophenyl)-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine
IUPAC Name	2-(2-bromophenyl)-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine
Molecular Weight	319.24
Molecular Formula	C16H19BrN2
InChI	XLVOBPSJQPPHPA-UHFFFAOYSA-N
InChI Key	InChI=1S/C16H19BrN2/c1-18(2)14-10-7-11-15(19(3)4)16(14)12-8-5-6-9-13(12)17/h5-11H,1-4H3
Purity	98%
Appearance	Brown solid
Isomeric SMILES	CN(C)C1=C(C(=CC=C1)N(C)C)C2=CC=CC=C2Br

Q&A

What is the molecular weight of 2,6-Bis(dimethylamino)-2'-bromo-1,1'-biphenyl?

The molecular weight is 319.24.

What is the minimum purity level of the product?

The minimum purity level is 98%.

What are some synonyms for 2,6-Bis(dimethylamino)-2'-bromo-1,1'-biphenyl?

Some synonyms include [1,1'-Biphenyl]-2,6-diamine, 2'-bromo-N2,N2,N6,N6-tetramethyl- and 2,6-Bis(dimethylamino)-2''-bromo-1,1''-biphenyl.

What is the chemical formula of 2,6-Bis(dimethylamino)-2'-bromo-1,1'-biphenyl?

The chemical formula is C16H19BrN2.

In what form does 2,6-Bis(dimethylamino)-2'-bromo-1,1'-biphenyl exist?

It exists in solid form.

What color does 2,6-Bis(dimethylamino)-2'-bromo-1,1'-biphenyl appear as?

It appears as brown in color.

What is the CAS registry number for 2,6-Bis(dimethylamino)-2'-bromo-1,1'-biphenyl?

CAS:1160556-63-7

What are the two functional groups present in 2,6-Bis(dimethylamino)-2'-bromo-1,1'-biphenyl?

The compound contains dimethylamino and bromo functional groups.

What is the molecular structure of 2,6-Bis(dimethylamino)-2'-bromo-1,1'-biphenyl?

The molecular structure consists of a biphenyl ring with two dimethylamino and one bromo substituents.