ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

2,6-Bis(5-methyl-4,5-dihydrooxazol-2-yl)pyridine

Catalog Number ACM799766408
CAS 799766-40-8
Synonyms 5-Methyl-2-[6-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)pyridin-2-yl]-4,5-dihydro-1,3-oxazole
IUPAC Name 5-methyl-2-[6-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)pyridin-2-yl]-4,5-dihydro-1,3-oxazole
Molecular Weight 245.28
Molecular Formula C13H15N3O2
InChI TURHBXWGKUUEDH-UHFFFAOYSA-N
InChI Key InChI=1S/C13H15N3O2/c1-8-6-14-12(17-8)10-4-3-5-11(16-10)13-15-7-9(2)18-13/h3-5,8-9H,6-7H2,1-2H3
Purity 98%
Isomeric SMILES CC1CN=C(O1)C2=NC(=CC=C2)C3=NCC(O3)C
Q&A

What is the CAS number of the chemical compound 2,6-Bis(5-methyl-4,5-dihydrooxazol-2-yl)pyridine?

The CAS number is 799766-40-8.

What is the molecular weight of 2,6-Bis(5-methyl-4,5-dihydrooxazol-2-yl)pyridine?

The molecular weight is 245.28.

What is the product name of the chemical compound with the synonyms Pyridine, 2,6-bis(4,5-dihydro-5-methyl-2-oxazolyl)?

The product name is Pyridine, 2,6-bis(4,5-dihydro-5-methyl-2-oxazolyl).

What are the synonyms for 2,6-Bis(5-methyl-4,5-dihydrooxazol-2-yl)pyridine?

The synonyms are Pyridine, 2,6-bis(4,5-dihydro-5-methyl-2-oxazolyl) and 2,6-Bis(5-methyl-4,5-dihydrooxazol-2-yl)pyridine.

What is the molecular formula of 2,6-Bis(5-methyl-4,5-dihydrooxazol-2-yl)pyridine?

The molecular formula is C13H15N3O2.

What is the predicted boiling point of 2,6-Bis(5-methyl-4,5-dihydrooxazol-2-yl)pyridine?

The predicted boiling point is 428.5±30.0 °C.

What is the predicted pka value of 2,6-Bis(5-methyl-4,5-dihydrooxazol-2-yl)pyridine?

The predicted pka value is 3.89±0.70.

What is the predicted density of 2,6-Bis(5-methyl-4,5-dihydrooxazol-2-yl)pyridine?

The predicted density is 1.34±0.1 g/cm3.

How many nitrogen atoms are present in the chemical structure of 2,6-Bis(5-methyl-4,5-dihydrooxazol-2-yl)pyridine?

There are three nitrogen atoms present in the chemical structure.

What is the predicted molecular weight of 2,6-Bis(5-methyl-4,5-dihydrooxazol-2-yl)pyridine?

The predicted molecular weight is 245.28.

Please kindly note that our products and services are for research use only.