2,5-Diphenyloxazole

Catalog Number	ACM92717-1
CAS	92-71-7
Structure
Synonyms	DPO; PPO
IUPAC Name	2,5-diphenyl-1,3-oxazole
Molecular Weight	221.25
Molecular Formula	C15H11NO
Canonical SMILES	C1=CC=C(C=C1)C2=CN=C(O2)C3=CC=CC=C3
InChI	CNRNYORZJGVOSY-UHFFFAOYSA-N
InChI Key	InChI=1S/C15H11NO/c1-3-7-12(8-4-1)14-11-16-15(17-14)13-9-5-2-6-10-13/h1-11H
Boiling Point	360ºC
Melting Point	72-74 °C-lit
Flash Point	162.3ºC
Purity	99%
Density	1.06
Appearance	Green powder
EC Number	202-181-3
Exact Mass	221.08400
Isomeric SMILES	C1=CC=C(C=C1)C2=CN=C(O2)C3=CC=CC=C3

Q&A

What is the molecular weight of 2,5-Diphenyloxazole?

The molecular weight of 2,5-Diphenyloxazole is 221.25.

What are the different product categories that 2,5-Diphenyloxazole falls under?

2,5-Diphenyloxazole falls under categories such as Oxazole&Isoxazole, Fluorescence/Luminescence Spectroscopy, Laser Dyes, Scintillation Reagents, and more.

What are some synonyms for 2,5-Diphenyloxazole?

Some synonyms for 2,5-Diphenyloxazole include 2,5-Diphenylisoxazole, Polyphenylene ether, and DPO.

What is the boiling point of 2,5-Diphenyloxazole?

The boiling point of 2,5-Diphenyloxazole is 360°C.

How is 2,5-Diphenyloxazole synthesized?

2,5-Diphenyloxazole is synthesized by reacting benzoylaminoacetic acid with thionyl chloride, benzene, aluminum trichloride, and sulfuric acid in a specific process.

What are some uses of 2,5-Diphenyloxazole?

2,5-Diphenyloxazole can be used as a dopant in plastic scintillators, for radioactive labelling on peptide substrates, and in the fabrication of organic luminescent materials for LEDs.

What color is 2,5-Diphenyloxazole?

2,5-Diphenyloxazole is white in color.

How is 2,5-Diphenyloxazole purified?

2,5-Diphenyloxazole can be distilled in steam and crystallized from ligroin for purification.

What is the hazard associated with 2,5-Diphenyloxazole?

2,5-Diphenyloxazole may cause irritation.

What is the stability of 2,5-Diphenyloxazole?

2,5-Diphenyloxazole is stable but incompatible with strong oxidizing agents.