2,5-Dichloroterephthalic acid

Catalog Number	ACM13799901-2
CAS	13799-90-1
Structure
Synonyms	Dichloroterephthalicacid; 2,5-Dichlorobenzene-1,4-dicarboxylic acid
IUPAC Name	2,5-dichloroterephthalic acid
Molecular Weight	235.02
Molecular Formula	C8H4O4Cl2
InChI	InChI=1S/C8H4Cl2O4/c9-5-1-3(7(11)12)6(10)2-4(5)8(13)14/h1-2H,(H,11,12)(H,13,14)
InChI Key	LMOSYFZLPBHEOW-UHFFFAOYSA-N
Boiling Point	306 °C
Melting Point	306 °C
Purity	98%
Appearance	Off-white powder
Storage	Store under inert gas
Complexity	230
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
EC Number	237-454-6
Exact Mass	233.9486640g/mol
Formal Charge	0
Heavy Atom Count	14
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
MDL Number	MFCD00058982
Monoisotopic Mass	233.9486640g/mol
Rotatable Bond Count	2
Topological Polar Surface Area	74.6Ų

Q&A

What is the molecular formula of 2,5-Dichloroterephthalic acid?

The molecular formula of 2,5-Dichloroterephthalic acid is C8H4Cl2O4.

What are the synonyms for 2,5-Dichloroterephthalic acid?

The synonyms for 2,5-Dichloroterephthalic acid are 2,5-dichlorobenzene-1,4-dicarboxylic acid and 1,4-Benzenedicarboxylic acid, 2,5-dichloro-.

What is the molecular weight of 2,5-Dichloroterephthalic acid?

The molecular weight of 2,5-Dichloroterephthalic acid is 235.02 g/mol.

What is the IUPAC name of 2,5-Dichloroterephthalic acid?

The IUPAC name of 2,5-Dichloroterephthalic acid is 2,5-dichloroterephthalic acid.

What is the InChI of 2,5-Dichloroterephthalic acid?

The InChI of 2,5-Dichloroterephthalic acid is InChI=1S/C8H4Cl2O4/c9-5-1-3(7(11)12)6(10)2-4(5)8(13)14/h1-2H,(H,11,12)(H,13,14).

What is the InChIKey of 2,5-Dichloroterephthalic acid?

The InChIKey of 2,5-Dichloroterephthalic acid is LMOSYFZLPBHEOW-UHFFFAOYSA-N.

What is the canonical SMILES of 2,5-Dichloroterephthalic acid?

The canonical SMILES of 2,5-Dichloroterephthalic acid is C1=C(C(=CC(=C1Cl)C(=O)O)Cl)C(=O)O.

What is the CAS number of 2,5-Dichloroterephthalic acid?

The CAS number of 2,5-Dichloroterephthalic acid is 13799-90-1.

What is the European Community (EC) number of 2,5-Dichloroterephthalic acid?

The European Community (EC) number of 2,5-Dichloroterephthalic acid is 237-454-6.

What is the hydrogen bond donor count and hydrogen bond acceptor count of 2,5-Dichloroterephthalic acid?

The hydrogen bond donor count of 2,5-Dichloroterephthalic acid is 2, and the hydrogen bond acceptor count is 4.