What is the molecular formula of 2,3-dihydroxyterephthalic acid?
The molecular formula of 2,3-dihydroxyterephthalic acid is C8H6O6.
What is the molecular weight of 2,3-dihydroxyterephthalic acid?
The molecular weight of 2,3-dihydroxyterephthalic acid is 198.13 g/mol.
What is the IUPAC name of 2,3-dihydroxyterephthalic acid?
The IUPAC name of 2,3-dihydroxyterephthalic acid is 2,3-dihydroxyterephthalic acid.
What is the InChI of 2,3-dihydroxyterephthalic acid?
The InChI of 2,3-dihydroxyterephthalic acid is InChI=1S/C8H6O6/c9-5-3(7(11)12)1-2-4(6(5)10)8(13)14/h1-2,9-10H,(H,11,12)(H,13,14).
What is the InChIKey of 2,3-dihydroxyterephthalic acid?
The InChIKey of 2,3-dihydroxyterephthalic acid is OHLSHRJUBRUKAN-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-dihydroxyterephthalic acid?
The canonical SMILES of 2,3-dihydroxyterephthalic acid is C1=CC(=C(C(=C1C(=O)O)O)O)C(=O)O.
What is the CAS number of 2,3-dihydroxyterephthalic acid?
The CAS number of 2,3-dihydroxyterephthalic acid is 19829-72-2.
What is the European Community (EC) number of 2,3-dihydroxyterephthalic acid?
The European Community (EC) number of 2,3-dihydroxyterephthalic acid is 243-354-3.
What is the UNII of 2,3-dihydroxyterephthalic acid?
The UNII of 2,3-dihydroxyterephthalic acid is F9S7RAD6FM.
What is the XLogP3 value of 2,3-dihydroxyterephthalic acid?
The XLogP3 value of 2,3-dihydroxyterephthalic acid is 1.5.
