2,3'-Bipyridine

Catalog Number	ACM581500
CAS	581-50-0
Structure
Synonyms	2-(Pyridin-3-yl)pyridine; Isonicoteine
IUPAC Name	2-pyridin-3-ylpyridine
Molecular Weight	156.18
Molecular Formula	C10H8N2
InChI	VEKIYFGCEAJDDT-UHFFFAOYSA-N
InChI Key	InChI=1S/C10H8N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h1-8H
Boiling Point	295.3 °C at 760 mmHg
Melting Point	30-32 °C
Purity	98%
Appearance	Liquid
Isomeric SMILES	C1=CC=NC(=C1)C2=CN=CC=C2

Q&A

What is the chemical formula of 2,3'-Bipyridine?

The chemical formula of 2,3'-Bipyridine is C10H8N2.

What is the molecular weight of 2,3'-Bipyridine?

The molecular weight of 2,3'-Bipyridine is 156.18.

What are some synonyms of 2,3'-Bipyridine?

Some synonyms of 2,3'-Bipyridine include 2-(Pyridin-3-yl)-pyridine, 2-(3-pyridyl)pyridine, BP11592, and alpha,beta'-bipyridine.

What is the melting point of 2,3'-Bipyridine?

The melting point of 2,3'-Bipyridine is 30-32 °C.

In what solvents is 2,3'-Bipyridine sparingly soluble?

2,3'-Bipyridine is sparingly soluble in chloroform.

What is the refractive index of 2,3'-Bipyridine?

The refractive index of 2,3'-Bipyridine is 1.6223.

What is the hazard class of 2,3'-Bipyridine?

The hazard class of 2,3'-Bipyridine is class 3.

Where is the product 2,3'-Bipyridine commonly found?

The compound Isonicoteine, found in fragrance products, contains 2,3'-Bipyridine.

How is 2,3'-Bipyridine described in terms of appearance?

2,3'-Bipyridine is described as a clear, faint yellow liquid.

What is the packing group classification of 2,3'-Bipyridine?

The packing group classification of 2,3'-Bipyridine is III.