| Catalog Number |
ACM136869493 |
| CAS |
136869-49-3 |
| Structure |
 |
| Description |
2,2'-Bipyridine-3,3'-dicarbonitrile (2,2'-BPDCN) is a nitrogen-containing heterocyclic compound that has been studied extensively for its potential applications in various fields. It has been used in the synthesis of various organic compounds, in the development of novel catalysts and ligands, and in the study of medicinal chemistry and drug design. |
| Synonyms |
2-(3-Cyanopyridin-2-yl)pyridine-3-carbonitrile |
| IUPAC Name |
2-(3-cyanopyridin-2-yl)pyridine-3-carbonitrile |
| Molecular Weight |
206.208 g/mol |
| Molecular Formula |
C12H6N4 |
| Canonical SMILES |
C1=CC(=C(N=C1)C2=C(C=CC=N2)C#N)C#N |
| InChI |
InChI=1S/C12H6N4/c13-7-9-3-1-5-15-11(9)12-10(8-14)4-2-6-16-12/h1-6H |
| InChI Key |
JJKQATMWMIMXAI-UHFFFAOYSA-N |
| Boiling Point |
447.0±45.0 °C(Predicted) |
| Purity |
98% |
| Application |
2,2'-BPDCN has been extensively studied for its potential applications in various fields. It has been used in the synthesis of organic compounds, in the development of novel catalysts and ligands, and in the study of medicinal chemistry and drug design. In addition, 2,2'-BPDCN has been used in the study of the structure and properties of polymers, in the fabrication of nanomaterials, and in the development of sensors and detectors. |
| Exact Mass |
206.05900 |
| Isomeric SMILES |
C1=CC(=C(N=C1)C2=C(C=CC=N2)C#N)C#N |
| Properties |
2,2'-BPDCN has been studied for its potential applications in medicinal chemistry and drug design. It has been found to have anti-inflammatory, anti-fungal, and anti-viral properties, as well as the ability to bind to and activate specific target molecules. In addition, it has been shown to have the ability to modulate the activity of certain enzymes and to regulate the expression of certain genes. |
