2,2':6',2'':6'',2'''-Quaterpyridine

Catalog Number	ACM4392830-1
CAS	4392-83-0
Structure
Synonyms	2-Pyridin-2-yl-6-(6-pyridin-2-ylpyridin-2-yl)pyridine
IUPAC Name	2-pyridin-2-yl-6-(6-pyridin-2-ylpyridin-2-yl)pyridine
Molecular Weight	310.35
Molecular Formula	C20H14N4
InChI	SSZWMEZKBBAJLB-UHFFFAOYSA-N
InChI Key	InChI=1S/C20H14N4/c1-3-13-21-15(7-1)17-9-5-11-19(23-17)20-12-6-10-18(24-20)16-8-2-4-14-22-16/h1-14H
Boiling Point	501.0±45.0 °C(Predicted)
Melting Point	219-220 °C
Purity	97%
Appearance	Off-white powder
Exact Mass	310.12200
Isomeric SMILES	C1=CC=NC(=C1)C2=NC(=CC=C2)C3=CC=CC(=N3)C4=CC=CC=N4

Q&A

What is the full chemical name of the compound with the CAS number 4392-83-0?

The compound's full chemical name is 2,2':6',2'':6'',2'''-Quaterpyridine.

What are some synonyms for 2,2':6',2'':6'',2'''-Quaterpyridine?

Some synonyms for 2,2':6',2'':6'',2'''-Quaterpyridine are Carbamicacid, N-3-cyclohexen-1-yl-, 1,7-dimethylethylester.

What is the molecular formula of 2,2':6',2'':6'',2'''-Quaterpyridine?

The molecular formula of 2,2':6',2'':6'',2'''-Quaterpyridine is C20H14N4.

What is the melting point of 2,2':6',2'':6'',2'''-Quaterpyridine?

The melting point of 2,2':6',2'':6'',2'''-Quaterpyridine is 219-220 °C.

What is the predicted density of 2,2':6',2'':6'',2'''-Quaterpyridine?

The predicted density of 2,2':6',2'':6'',2'''-Quaterpyridine is 1.202±0.06 g/cm3.

What is the predicted pka value of 2,2':6',2'':6'',2'''-Quaterpyridine?

The predicted pka value of 2,2':6',2'':6'',2'''-Quaterpyridine is 3.38±0.10.

What is the predicted boiling point of 2,2':6',2'':6'',2'''-Quaterpyridine?

The predicted boiling point of 2,2':6',2'':6'',2'''-Quaterpyridine is 501.0±45.0 °C.

Where is the recommended storage temperature for 2,2':6',2'':6'',2'''-Quaterpyridine?

The recommended storage temperature for 2,2':6',2'':6'',2'''-Quaterpyridine is in an inert atmosphere at room temperature.

How does the molecular weight of 2,2':6',2'':6'',2'''-Quaterpyridine compare to other compounds?

The molecular weight of 2,2':6',2'':6'',2'''-Quaterpyridine is 310.35.

What are the potential uses of 2,2':6',2'':6'',2'''-Quaterpyridine based on its chemical properties?

The potential uses of 2,2':6',2'':6'',2'''-Quaterpyridine are determined by its chemical properties, such as its melting point, boiling point, density, and pka value.