(1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine

Catalog Number	ACM341968716-1
CAS	341968-71-6
Structure
Synonyms	(1S,2S)-(2-Diphenylphosphino)-1-Methyl-2-Phenylethylamine
IUPAC Name	(1S,2S)-1-diphenylphosphanyl-1-phenylpropan-2-amine
Molecular Weight	319.38
Molecular Formula	C21H22NP
InChI	JWZAIGGNEGTDMG-LAUBAEHRSA-N
InChI Key	InChI=1S/C21H22NP/c1-17(22)21(18-11-5-2-6-12-18)23(19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-17,21H,22H2,1H3/t17-,21+/m0/s1
Boiling Point	450.0±38.0 °C(Predicted)
Melting Point	100-107 °C
Purity	98%
Appearance	Solid
Isomeric SMILES	C[C@@H]([C@H](C1=CC=CC=C1)P(C2=CC=CC=C2)C3=CC=CC=C3)N
pKa	8.87±0.10(Predicted)

Q&A

What is the chemical structure of the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

The chemical structure of the compound is C21H22NP.

What is the CAS number of the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

The CAS number is 341968-71-6.

How many heavy atoms are present in the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

There are 23 heavy atoms present.

What is the IUPAC name of the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

The IUPAC name is (1S,2S)-1-diphenylphosphanyl-1-phenylpropan-2-amine.

What is the molecular weight of the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

The molecular weight is 319.4g/mol.

How many rotatable bonds are present in the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

There are 5 rotatable bonds present.

What is the exact mass of the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

The exact mass is 319.148986704.

What is the Canonical SMILES representation of the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

The Canonical SMILES is CC(C(C1=CC=CC=C1)P(C2=CC=CC=C2)C3=CC=CC=C3)N.

What is the InChIKey of the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

The InChIKey is JWZAIGGNEGTDMG-LAUBAEHRSA-N.

What is the formula for the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

The formula is C21H22NP.