ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

(1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine

Catalog Number ACM341968716-1
CAS 341968-71-6
Structure {[CurrentData.Name]}
Synonyms (1S,2S)-(2-Diphenylphosphino)-1-Methyl-2-Phenylethylamine
IUPAC Name (1S,2S)-1-diphenylphosphanyl-1-phenylpropan-2-amine
Molecular Weight 319.38
Molecular Formula C21H22NP
InChI JWZAIGGNEGTDMG-LAUBAEHRSA-N
InChI Key InChI=1S/C21H22NP/c1-17(22)21(18-11-5-2-6-12-18)23(19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-17,21H,22H2,1H3/t17-,21+/m0/s1
Boiling Point 450.0±38.0 °C(Predicted)
Melting Point 100-107 °C
Purity 98%
Appearance Solid
Isomeric SMILES C[C@@H]([C@H](C1=CC=CC=C1)P(C2=CC=CC=C2)C3=CC=CC=C3)N
pKa 8.87±0.10(Predicted)
Q&A

What is the chemical structure of the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

The chemical structure of the compound is C21H22NP.

What is the CAS number of the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

The CAS number is 341968-71-6.

How many heavy atoms are present in the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

There are 23 heavy atoms present.

What is the IUPAC name of the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

The IUPAC name is (1S,2S)-1-diphenylphosphanyl-1-phenylpropan-2-amine.

What is the molecular weight of the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

The molecular weight is 319.4g/mol.

How many rotatable bonds are present in the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

There are 5 rotatable bonds present.

What is the exact mass of the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

The exact mass is 319.148986704.

What is the Canonical SMILES representation of the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

The Canonical SMILES is CC(C(C1=CC=CC=C1)P(C2=CC=CC=C2)C3=CC=CC=C3)N.

What is the InChIKey of the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

The InChIKey is JWZAIGGNEGTDMG-LAUBAEHRSA-N.

What is the formula for the compound (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine?

The formula is C21H22NP.

Please kindly note that our products and services are for research use only.