| Catalog Number |
ACM18657573-2 |
| CAS |
18657-57-3 |
| Structure |
 |
| Description |
1H-Indene, 3,3'-(1,2-ethanediyl)bis- (I3E) is a synthetic compound that has a variety of uses in scientific research. It is a relatively new compound, and its use in research is still in its infancy. I3E has unique properties that make it an attractive choice for a variety of research applications. |
| IUPAC Name |
3-[2-(3H-inden-1-yl)ethyl]-1H-indene |
| Molecular Weight |
258.4 g/mol |
| Molecular Formula |
C20H18 |
| Canonical SMILES |
C1C=C(C2=CC=CC=C21)CCC3=CCC4=CC=CC=C43 |
| InChI |
InChI=1S/C20H18/c1-3-7-19-15(5-1)9-11-17(19)13-14-18-12-10-16-6-2-4-8-20(16)18/h1-8,11-12H,9-10,13-14H2 |
| InChI Key |
CQAQBIQKEFJNRZ-UHFFFAOYSA-N |
| Appearance |
Powder |
| Application |
1H-Indene, 3,3'-(1,2-ethanediyl)bis- is used in a variety of scientific research applications due to its unique properties. It has been used in the synthesis of a variety of organic compounds, including alkaloids, flavonoids, and other natural products. It has also been used as a catalyst in organic synthesis reactions, such as the synthesis of amines, alcohols, and other organic compounds. Additionally, 1H-Indene, 3,3'-(1,2-ethanediyl)bis- has been used in the synthesis of polymers, such as polyurethanes, and in the synthesis of nanomaterials. |
| Properties |
The biochemical and physiological effects of 1H-Indene, 3,3'-(1,2-ethanediyl)bis- are not fully understood. However, it has been shown to have some anti-inflammatory and anti-oxidant effects in laboratory studies. Additionally, it has been shown to have some effects on the metabolism of lipids and carbohydrates. |
