ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

(11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane

Catalog Number ACM1092063994
CAS 1092063-99-4
Molecular Weight 326.18
Molecular Formula C22H20BP
Melting Point 201-205 °C
Purity 97%
Q&A

What is the molecular formula of (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane?

The molecular formula is C22H17BP.

What is the exact mass of (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane?

The exact mass is 323.1160927.

How many heavy atoms are present in (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane?

There are 24 heavy atoms present.

What is the canonical SMILES representation of (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane?

[B].C1C2=C(C3=CC=CC=C3C=C2)C4=C(CP1)C=CC5=CC=CC=C54

How many covalently-bonded units are there in (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane?

There are 2 covalently-bonded units.

Does (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane contain any defined atom stereocenter counts?

No, there are 0 defined atom stereocenter counts.

What is the topological polar surface area of (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane?

The topological polar surface area is 0.

What is the computed properties complexity of (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane?

The complexity is 380.

What is the InChIKey of (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane?

The InChIKey is MPDDAIHUKQRVPD-UHFFFAOYSA-N.

Are there any Depositor-Supplied Synonyms for (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane?

Yes, one of the Depositor-Supplied Synonyms is SCHEMBL3008144.

Please kindly note that our products and services are for research use only.