What is the molecular formula of (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane?
The molecular formula is C22H17BP.
What is the exact mass of (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane?
The exact mass is 323.1160927.
How many heavy atoms are present in (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane?
There are 24 heavy atoms present.
What is the canonical SMILES representation of (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane?
[B].C1C2=C(C3=CC=CC=C3C=C2)C4=C(CP1)C=CC5=CC=CC=C54
How many covalently-bonded units are there in (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane?
There are 2 covalently-bonded units.
Does (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane contain any defined atom stereocenter counts?
No, there are 0 defined atom stereocenter counts.
What is the topological polar surface area of (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane?
The topological polar surface area is 0.
What is the computed properties complexity of (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane?
The complexity is 380.
What is the InChIKey of (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane?
The InChIKey is MPDDAIHUKQRVPD-UHFFFAOYSA-N.
Are there any Depositor-Supplied Synonyms for (11bR)-4,5-Dihydro-3H-dinaphtho[2,1-c:1',2'-e]phosphepine borane?
Yes, one of the Depositor-Supplied Synonyms is SCHEMBL3008144.
