| Catalog Number |
ACM109005109-2 |
| CAS |
109005-10-9 |
| Synonyms |
10,15-Dihydro-5H-5,10,15-triazadiindeno[1,2-a:1',2'-c]fluorene |
| IUPAC Name |
9,18,27-triazaheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1(20),2(10),3,5,7,11(19),12,14,16,21,23,25-dodecaene |
| Molecular Weight |
345.39 |
| Molecular Formula |
C24H15N3 |
| Canonical SMILES |
C1=CC=C2C(=C1)C3=C(N2)C4=C(C5=C3NC6=CC=CC=C65)NC7=CC=CC=C74 |
| InChI |
InChI=1S/C24H15N3/c1-4-10-16-13(7-1)19-22(25-16)20-15-9-3-6-12-18(15)27-24(20)21-14-8-2-5-11-17(14)26-23(19)21/h1-12,25-27H |
| InChI Key |
IQRFZFGTHZJRFV-UHFFFAOYSA-N |
| Appearance |
Soild |
| Application |
10,15-Dihydro-5H-diindolo[3,2-a:3',2'-c]carbazole, commonly referred to as triazacycloheptene (TAT), serves as a crucial component in organic semiconductor technologies. Its unique structure, formed by fusing three indoles in orthogonal positions to a single benzene ring, creates a planar, C3 symmetric π-extended conjugated system. This configuration endows TAT with excellent electron-carrying capabilities, often utilized as an electron transport element in complex molecular arrangements. The triazatriene framework, characterized by an indole cyclic trimer with a non-localized π-system, leads to strong π-π stacking capabilities and a tendency to form columnar supramolecular assemblies. Consequently, TAT-based organic semiconductors exhibit high hole mobility, making them ideal for use as hole transport layers in advanced electronic applications. |
| Complexity |
505 |
| Covalently-Bonded Unit Count |
1 |
| Exact Mass |
345.126598g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
27 |
| Monoisotopic Mass |
345.126598g/mol |
| Rotatable Bond Count |
0 |
